Compound 998
Identifiers
- Canonical SMILES:
CC(C)(C)C[C@H]1N[C@H]([C@H](c2ccc(F)c(Cl)c2)[C@@]11C(=O)Nc2cc(Cl)c(F)cc12)C(=O)NCC[C@@H](O)C[C@@H](O)CC(O)=O
- IUPAC name:
(3R,5R)-7-[[(2'R,3S,3'R,5'R)-6-chloro-3'-(3-chloro-4-fluorophenyl)-5'-(2,2-dimethylpropyl)-5-fluoro-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carbonyl]amino]-3,5-dihydroxyheptanoic acid
- InChi:
InChI=1S/C30H35Cl2F2N3O6/c1-29(2,3)13-23-30(17-11-21(34)19(32)12-22(17)36-28(30)43)25(14-4-5-20(33)18(31)8-14)26(37-23)27(42)35-7-6-15(38)9-16(39)10-24(40)41/h4-5,8,11-12,15-16,23,25-26,37-39H,6-7,9-10,13H2,1-3H3,(H,35,42)(H,36,43)(H,40,41)/t15-,16-,23-,25+,26-,30+/m1/s1
- InChiKey:
FXOIWZYATMQQKC-BJADBZOVSA-N
External links
25000114 |
External search
Bibliography (1)
Publication | Name |
---|---|
Shaomeng Wang, Dongguang Qin, Jianyong Chen, Shanghai Yu, The Regents Of The University Of Michigan. . New small molecule inhibitors of mdm2 and the uses thereof None. | 319-18 |
Pharmacological data
Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
---|---|---|---|
1 | 3 | 0 | 0 |
Targets
PPI family | Best activity | Diseases | MMoA |
---|---|---|---|
MDM2-Like / P53 | 5.45 | cancer | Inhibition |
Physicochemical filters
Descriptor | Lipinski's RO5 | Veber | Pfizer's 3/75 | |
---|---|---|---|---|
Compliance | ||||
MW | 641.19 g/mol | |||
HBA | 9 | |||
HBD | 6 | |||
HBA + HBD | 15 | |||
AlogP | 0.91 | |||
TPSA | 147.99 | |||
RB | 11 |
Radar chart
PCA : iPPI-DB chemical space
PCA : Correlation circle
Efficiencies: iPPI-DB biplot LE versus LLE
Summary
Bibliographic ressources | Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
---|---|---|---|---|
1 | 1 | 3 | 0 | 0 |
Pharmacological data
Bibliography | Name | Target | Competition | Assay type | Assay name | Cell line | Activity type | Activity |
---|---|---|---|---|---|---|---|---|
WO2008036168 | 319-18 | MDM2 Q00987 |
|
Biochemical assay | Fluorescence Polarization | pIC50 (half maximal inhibitory concentration, -log10) | 5.45 | |
WO2008036168 | 319-18 | MDM2 Q00987 |
|
Cellular assay | Proliferation assay | LNCaP cells | pIC50 (half maximal inhibitory concentration, -log10) | 4.52 |
WO2008036168 | 319-18 | MDM2 Q00987 |
|
Cellular assay | Proliferation assay | HCT-116 cells p53WT | pIC50 (half maximal inhibitory concentration, -log10) | 4.52 |
WO2008036168 | 319-18 | MDM2 Q00987 |
|
Cellular assay | Proliferation assay | PC-3 cells | pIC50 (half maximal inhibitory concentration, -log10) | 4.52 |
Ta | Structure | Name | Drugbank ID |
---|---|---|---|
0.8352 | SAR-405838 | DB12541 | |
0.6711 | Milademetan | DB15257 | |
0.5436 | SLV-334 | DB15356 | |
0.5274 | Daglutril | DB05796 | |
0.5268 | Degarelix | DB06699 | |
0.5208 | Mosapramine | DB13676 | |
0.5048 | Acyline | DB11906 | |
0.5022 | Idasanutlin | DB12325 | |
0.5000 | Abarelix | DB00106 | |
0.4923 | Ezetimibe | DB00973 | |
0.4922 | Prajmaline | DB13555 | |
0.4922 | Ajmaline | DB01426 | |
0.4914 | MK-3207 | DB12424 | |
0.4870 | Benazeprilat | DB14125 | |
0.4862 | BIO-11006 | DB14886 |