Compound 995
Identifiers
- Canonical SMILES:
CC(C)(C)C[C@H]1N[C@H]([C@H](c2ccc(F)c(Cl)c2)[C@@]11C(=O)Nc2cc(Cl)c(F)cc12)C(=O)NCC[C@H]1CC[C@@H](O)C1
- IUPAC name:
(2'R,3S,3'R,5'R)-6-chloro-3'-(3-chloro-4-fluorophenyl)-5'-(2,2-dimethylpropyl)-5-fluoro-N-[2-(3-hydroxycyclopentyl)ethyl]-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxamide
- InChi:
InChI=1S/C30H35Cl2F2N3O3/c1-29(2,3)14-24-30(18-12-22(34)20(32)13-23(18)36-28(30)40)25(16-5-7-21(33)19(31)11-16)26(37-24)27(39)35-9-8-15-4-6-17(38)10-15/h5,7,11-13,15,17,24-26,37-38H,4,6,8-10,14H2,1-3H3,(H,35,39)(H,36,40)/t15-,17-,24-,25+,26-,30+/m1/s1
- InChiKey:
XLSHWAWDBJTNLP-LLHAZNGGSA-N
External links
25002081 |
External search
Bibliography (1)
Publication | Name |
---|---|
Shaomeng Wang, Dongguang Qin, Jianyong Chen, Shanghai Yu, The Regents Of The University Of Michigan. . New small molecule inhibitors of mdm2 and the uses thereof None. | 319-5 |
Pharmacological data
Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
---|---|---|---|
1 | 3 | 0 | 0 |
Targets
PPI family | Best activity | Diseases | MMoA |
---|---|---|---|
MDM2-Like / P53 | 7.26 | cancer | Inhibition |
Physicochemical filters
Descriptor | Lipinski's RO5 | Veber | Pfizer's 3/75 | |
---|---|---|---|---|
Compliance | ||||
MW | 593.20 g/mol | |||
HBA | 6 | |||
HBD | 4 | |||
HBA + HBD | 10 | |||
AlogP | 5.46 | |||
TPSA | 90.46 | |||
RB | 7 |
Radar chart
PCA : iPPI-DB chemical space
PCA : Correlation circle
Efficiencies: iPPI-DB biplot LE versus LLE
Summary
Bibliographic ressources | Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
---|---|---|---|---|
1 | 1 | 3 | 0 | 0 |
Pharmacological data
Bibliography | Name | Target | Competition | Assay type | Assay name | Cell line | Activity type | Activity |
---|---|---|---|---|---|---|---|---|
WO2008036168 | 319-5 | MDM2 Q00987 |
|
Biochemical assay | Fluorescence Polarization | pIC50 (half maximal inhibitory concentration, -log10) | 7.26 | |
WO2008036168 | 319-5 | MDM2 Q00987 |
|
Cellular assay | Proliferation assay | LNCaP cells | pIC50 (half maximal inhibitory concentration, -log10) | 6.22 |
WO2008036168 | 319-5 | MDM2 Q00987 |
|
Cellular assay | Proliferation assay | HCT-116 cells p53WT | pIC50 (half maximal inhibitory concentration, -log10) | 6.00 |
WO2008036168 | 319-5 | MDM2 Q00987 |
|
Cellular assay | Proliferation assay | PC-3 cells | pIC50 (half maximal inhibitory concentration, -log10) | 5.02 |
Ta | Structure | Name | Drugbank ID |
---|---|---|---|
0.8636 | SAR-405838 | DB12541 | |
0.6818 | Milademetan | DB15257 | |
0.5608 | SLV-334 | DB15356 | |
0.5436 | Daglutril | DB05796 | |
0.5294 | Mosapramine | DB13676 | |
0.5135 | Degarelix | DB06699 | |
0.5110 | MK-3207 | DB12424 | |
0.5089 | Idasanutlin | DB12325 | |
0.5079 | Ezetimibe | DB00973 | |
0.5030 | (3S)-N-(3-CHLORO-2-METHYLPHENYL)-1-CYCLOHEXYL-5-OXOPYRROLIDINE-3-CARBOXAMIDE | DB07090 | |
0.5030 | (3S)-N-(5-CHLORO-2-METHYLPHENYL)-1-CYCLOHEXYL-5-OXOPYRROLIDINE-3-CARBOXAMIDE | DB07222 | |
0.4974 | OPC-51803 | DB05838 | |
0.4947 | Benazeprilat | DB14125 | |
0.4922 | OPC-14523 | DB05422 | |
0.4902 | Acyline | DB11906 |