Compound 974
Identifiers
- Canonical SMILES:
CC(C)c1cc(C(=O)c2ccc(Oc3ccccc3)cc2)c(O)c(O)c1O
- IUPAC name:
(4-phenoxyphenyl)-(2,3,4-trihydroxy-5-propan-2-ylphenyl)methanone
- InChi:
InChI=1S/C22H20O5/c1-13(2)17-12-18(21(25)22(26)20(17)24)19(23)14-8-10-16(11-9-14)27-15-6-4-3-5-7-15/h3-13,24-26H,1-2H3
- InChiKey:
BPCUAEBLJFPRKL-UHFFFAOYSA-N
External links
![]() 24800648 |
![]() CHEMBL270268 |
![]() 23326055 |
External search
![]() |
![]() |
![]() |
![]() |
![]() |
Bibliography (1)
Publication | Name |
---|---|
Tang G, Nikolovska-Coleska Z, Qiu S, Yang CY, Guo J, Wang S. . Acylpyrogallols as inhibitors of antiapoptotic Bcl-2 proteins. Journal of medicinal chemistry. | 6 |
Pharmacological data
Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
---|---|---|---|
2 | 0 | 0 | 0 |
Targets
PPI family | Best activity | Diseases | MMoA |
---|---|---|---|
BCL2-Like / BAX | 5.51 | cancer | Inhibition |
Physicochemical filters
Descriptor | Lipinski's RO5 | Veber | Pfizer's 3/75 | |
---|---|---|---|---|
Compliance | ||||
MW | 364.13 g/mol | |||
HBA | 5 | |||
HBD | 3 | |||
HBA + HBD | 8 | |||
AlogP | 5.92 | |||
TPSA | 86.99 | |||
RB | 5 |
Radar chart
PCA : iPPI-DB chemical space
PCA : Correlation circle
Efficiencies: iPPI-DB biplot LE versus LLE
Summary
Bibliographic ressources | Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
---|---|---|---|---|
1 | 2 | 0 | 0 | 0 |
Pharmacological data
Bibliography | Name | Target | Competition | Assay type | Assay name | Cell line | Activity type | Activity |
---|---|---|---|---|---|---|---|---|
18237106 | 6 | BCL2 P10415 |
|
Biochemical assay | ELISA | pIC50 (half maximal inhibitory concentration, -log10) | 5.47 | |
18237106 | 6 | MCL1 Q07820 |
|
Biochemical assay | Fluorescence Polarization | pIC50 (half maximal inhibitory concentration, -log10) | 5.51 |
Ta | Structure | Name | Drugbank ID |
---|---|---|---|
0.7385 | Oxybenzone | DB01428 | |
0.7273 | Dioxybenzone | DB11221 | |
0.6456 | Emodin | DB07715 | |
0.6338 | Hypericin | DB13014 | |
0.6176 | Apocynin | DB12618 | |
0.5974 | Quinalizarin | DB08660 | |
0.5750 | GC-24 | DB03788 | |
0.5682 | Fluorescin | DB07764 | |
0.5625 | Sobetirome | DB07425 | |
0.5625 | 4,4'-Dihydroxybenzophenone | DB07635 | |
0.5579 | LY-2300559 | DB13016 | |
0.5526 | Dantron | DB04816 | |
0.5469 | 2,2-bis(4-hydroxy-3-tert-butylphenyl)propane | DB13008 | |
0.5402 | Rheinanthrone | DB13175 | |
0.5395 | Anthralin | DB11157 |