Compound 972
Identifiers
- Canonical SMILES:
OC[C@@H](O)CCNC(=O)[C@@H]1N[C@H](C2CCCCC2)[C@@]2([C@H]1c1ccc(F)c(Cl)c1)C(=O)Nc1cc(Cl)c(F)cc21
- IUPAC name:
(2'R,3S,3'R,5'R)-6-chloro-3'-(3-chloro-4-fluorophenyl)-5'-cyclohexyl-N-[(3S)-3,4-dihydroxybutyl]-5-fluoro-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxamide
- InChi:
InChI=1S/C28H31Cl2F2N3O4/c29-18-10-15(6-7-20(18)31)23-24(26(38)33-9-8-16(37)13-36)35-25(14-4-2-1-3-5-14)28(23)17-11-21(32)19(30)12-22(17)34-27(28)39/h6-7,10-12,14,16,23-25,35-37H,1-5,8-9,13H2,(H,33,38)(H,34,39)/t16-,23-,24+,25+,28+/m0/s1
- InChiKey:
DLJFMKLDRBATES-AYOLOSBVSA-N
External links
![]() 59343779 |
External search
![]() |
![]() |
![]() |
![]() |
![]() |
Bibliography (1)
Publication | Name |
---|---|
Shaomeng Wang, Dongguang Qin, Jianyong Chen, Shanghai Yu, The Regents Of The University Of Michigan. . New small molecule inhibitors of mdm2 and the uses thereof None. | 319-4 |
Pharmacological data
Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
---|---|---|---|
1 | 3 | 0 | 0 |
Targets
PPI family | Best activity | Diseases | MMoA |
---|---|---|---|
MDM2-Like / P53 | 6.15 | cancer | Inhibition |
Physicochemical filters
Descriptor | Lipinski's RO5 | Veber | Pfizer's 3/75 | |
---|---|---|---|---|
Compliance | ||||
MW | 581.17 g/mol | |||
HBA | 7 | |||
HBD | 5 | |||
HBA + HBD | 12 | |||
AlogP | 3.75 | |||
TPSA | 110.69 | |||
RB | 7 |
Radar chart
PCA : iPPI-DB chemical space
PCA : Correlation circle
Efficiencies: iPPI-DB biplot LE versus LLE
Summary
Bibliographic ressources | Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
---|---|---|---|---|
1 | 1 | 3 | 0 | 0 |
Pharmacological data
Bibliography | Name | Target | Competition | Assay type | Assay name | Cell line | Activity type | Activity |
---|---|---|---|---|---|---|---|---|
WO2008036168 | 319-4 | MDM2 Q00987 |
|
Biochemical assay | Fluorescence Polarization | pIC50 (half maximal inhibitory concentration, -log10) | 6.15 | |
WO2008036168 | 319-4 | MDM2 Q00987 |
|
Cellular assay | Proliferation assay | LNCaP cells | pIC50 (half maximal inhibitory concentration, -log10) | 5.85 |
WO2008036168 | 319-4 | MDM2 Q00987 |
|
Cellular assay | Proliferation assay | HCT-116 cells p53WT | pIC50 (half maximal inhibitory concentration, -log10) | 5.30 |
WO2008036168 | 319-4 | MDM2 Q00987 |
|
Cellular assay | Proliferation assay | PC-3 cells | pIC50 (half maximal inhibitory concentration, -log10) | 4.73 |
Ta | Structure | Name | Drugbank ID |
---|---|---|---|
0.8596 | SAR-405838 | DB12541 | |
0.6802 | Milademetan | DB15257 | |
0.5270 | Degarelix | DB06699 | |
0.5210 | Mosapramine | DB13676 | |
0.5204 | SLV-334 | DB15356 | |
0.5050 | Daglutril | DB05796 | |
0.5049 | Acyline | DB11906 | |
0.5029 | (3S)-N-(3-CHLORO-2-METHYLPHENYL)-1-CYCLOHEXYL-5-OXOPYRROLIDINE-3-CARBOXAMIDE | DB07090 | |
0.5029 | (3S)-N-(5-CHLORO-2-METHYLPHENYL)-1-CYCLOHEXYL-5-OXOPYRROLIDINE-3-CARBOXAMIDE | DB07222 | |
0.5022 | Idasanutlin | DB12325 | |
0.5000 | Abarelix | DB00106 | |
0.4978 | MK-3207 | DB12424 | |
0.4897 | OPC-51803 | DB05838 | |
0.4847 | OPC-14523 | DB05422 | |
0.4845 | Brimapitide | DB15231 |