Compound 869
Identifiers
- Canonical SMILES:
OC(=O)[C@@H]1[C@@H]([C@@H](OC11C(=O)c2ccccc2C1=O)c1ccc(Cl)c(Cl)c1)C(=O)NC(=O)Nc1ccc(cc1)-c1csnn1
- InChi:
InChI=1S/C29H18Cl2N4O7S/c30-18-10-7-14(11-19(18)31)23-21(22(27(39)40)29(42-23)24(36)16-3-1-2-4-17(16)25(29)37)26(38)33-28(41)32-15-8-5-13(6-9-15)20-12-43-35-34-20/h1-12,21-23H,(H,39,40)(H2,32,33,38,41)/t21-,22-,23-/m0/s1
- InChiKey:
MXYALQDQBOVGKT-VABKMULXSA-N
External links
![]() 168318046 |
External search
|
|
|
|
|
Bibliography (1)
Pharmacological data
| Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|
| 1 | 0 | 0 | 0 |
Targets
| PPI family | Best activity | Diseases | MMoA |
|---|---|---|---|
| E2 / E1 | 6.82 | human papilloma virus infection | Inhibition |
Physicochemical filters
| Descriptor | Lipinski's RO5 | Veber | Pfizer's 3/75 | |
|---|---|---|---|---|
| Compliance | ||||
| MW | 636.03 g/mol | |||
| HBA | 11 | |||
| HBD | 3 | |||
| HBA + HBD | 14 | |||
| AlogP | 5.07 | |||
| TPSA | 164.65 | |||
| RB | 5 |
Radar chart
PCA : iPPI-DB chemical space
PCA : Correlation circle
Efficiencies: iPPI-DB biplot LE versus LLE
Summary
| Bibliographic ressources | Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|---|
| 1 | 1 | 0 | 0 | 0 |
| Ta | Structure | Name | Drugbank ID |
|---|---|---|---|
| 0.8710 | Bilh 434 | DB04330 | |
| 0.4274 | VTP-27999 | DB12416 | |
| 0.4096 | Methoserpidine | DB13631 | |
| 0.4055 | Deserpidine | DB01089 | |
| 0.4034 | Reserpine | DB00206 | |
| 0.3932 | Balhimycin | DB04111 | |
| 0.3916 | Virginiamycin S1 | DB04805 | |
| 0.3898 | Quinupristin | DB01369 | |
| 0.3887 | Bietaserpine | DB13575 | |
| 0.3870 | Proglumetacin | DB13527 | |
| 0.3862 | Deglucobalhimycin | DB02792 | |
| 0.3849 | METHYL 3-CHLORO-2-{3-[(2,5-DIHYDROXY-4-METHOXYPHENYL)AMINO]-3-OXOPROPYL}-4,6-DIHYDROXYBENZOATE | DB08464 | |
| 0.3849 | N,N-[2,5-O-Dibenzyl-glucaryl]-DI-[1-amino-indan-2-OL] | DB01887 | |
| 0.3833 | Milademetan | DB15257 | |
| 0.3831 | 2,5-dibenzyloxy-3-hydroxy-hexanedioic acid bis-[(2-hydroxy-indan-1-yl)-amide] | DB04190 |




