Compound 865
Identifiers
- Canonical SMILES:
C[C@H](N)c1cccc(c1)C(=O)N1C[C@H](C[C@H]1C(=O)N1CC[C@@H](C1)c1ccccc1)c1ccccc1
- IUPAC name:
[(2S,4R)-1-[3-(1-aminoethyl)benzoyl]-4-phenylpyrrolidin-2-yl]-[(3R)-3-phenylpyrrolidin-1-yl]methanone
- InChi:
InChI=1S/C30H33N3O2/c1-21(31)24-13-8-14-25(17-24)29(34)33-20-27(23-11-6-3-7-12-23)18-28(33)30(35)32-16-15-26(19-32)22-9-4-2-5-10-22/h2-14,17,21,26-28H,15-16,18-20,31H2,1H3/t21-,26-,27-,28-/m0/s1
- InChiKey:
IXDMKRKRHAHJTH-FYYOVZQQSA-N
External links
![]() 168318050 |
External search
|
|
|
|
|
Bibliography (1)
Pharmacological data
| Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|
| 1 | 0 | 0 | 0 |
Targets
| PPI family | Best activity | Diseases | MMoA |
|---|---|---|---|
| XIAP / Smac | 6.30 | cancer | Inhibition |
Physicochemical filters
| Descriptor | Lipinski's RO5 | Veber | Pfizer's 3/75 | |
|---|---|---|---|---|
| Compliance | ||||
| MW | 467.26 g/mol | |||
| HBA | 5 | |||
| HBD | 2 | |||
| HBA + HBD | 7 | |||
| AlogP | 3.95 | |||
| TPSA | 66.64 | |||
| RB | 5 |
Radar chart
PCA : iPPI-DB chemical space
PCA : Correlation circle
Efficiencies: iPPI-DB biplot LE versus LLE
Summary
| Bibliographic ressources | Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|---|
| 1 | 1 | 0 | 0 | 0 |
Pharmacological data
| Bibliography | Name | Target | Competition | Assay type | Assay name | Cell line | Activity type | Activity |
|---|---|---|---|---|---|---|---|---|
| WO2009152824 | 6 | XIAP P98170 |
|
Biochemical assay | alphascreen | pIC50 (half maximal inhibitory concentration, -log10) | 6.30 |
| Ta | Structure | Name | Drugbank ID |
|---|---|---|---|
| 0.7736 | D-phenylalanyl-N-(3-methylbenzyl)-L-prolinamide | DB07133 | |
| 0.7358 | D-phenylalanyl-N-benzyl-L-prolinamide | DB07143 | |
| 0.6930 | D-phenylalanyl-N-(3-chlorobenzyl)-L-prolinamide | DB06919 | |
| 0.6930 | D-phenylalanyl-N-{4-[amino(iminio)methyl]benzyl}-L-prolinamide | DB07005 | |
| 0.6903 | N-({(2S)-1-[(3R)-3-AMINO-4-(2-FLUOROPHENYL)BUTANOYL]PYRROLIDIN-2-YL}METHYL)BENZAMIDE | DB07779 | |
| 0.6846 | RU82197 | DB03268 | |
| 0.6842 | D-phenylalanyl-N-(3-fluorobenzyl)-L-prolinamide | DB07027 | |
| 0.6786 | N-(4-carbamimidoylbenzyl)-1-(3-phenylpropanoyl)-L-prolinamide | DB06942 | |
| 0.6546 | (3s,8ar)-3-(4-Hydroxybenzyl)Hexahydropyrrolo[1,2-a]Pyrazine-1,4-Dione | DB04520 | |
| 0.6538 | PPI-1019 | DB05832 | |
| 0.6535 | AGG-523 | DB15460 | |
| 0.6508 | Palonosetron | DB00377 | |
| 0.6452 | Tiropramide | DB13091 | |
| 0.6410 | 1-[3,3-Dimethyl-2-(2-Methylamino-Propionylamino)-Butyryl]-Pyrrolidine-2-Carboxylic Acid(1,2,3,4-Tetrahydro-Naphthalen-1-Yl)-Amide | DB02628 | |
| 0.6389 | N-Methylphenylalanyl-N-[(trans-4-aminocyclohexyl)methyl]-L-prolinamide | DB08187 |




