Compound 863
Identifiers
- Canonical SMILES:
Clc1cc(Cl)cc(c1)C1=C(C2CC2)[C@]2(Cc3ccc(Br)cc3)CCCN2C1=O
- IUPAC name:
8-[(4-bromophenyl)methyl]-1-cyclopropyl-2-(3,5-dichlorophenyl)-6,7-dihydro-5H-pyrrolizin-3-one
- InChi:
InChI=1S/C23H20BrCl2NO/c24-17-6-2-14(3-7-17)13-23-8-1-9-27(23)22(28)20(21(23)15-4-5-15)16-10-18(25)12-19(26)11-16/h2-3,6-7,10-12,15H,1,4-5,8-9,13H2/t23-/m1/s1
- InChiKey:
NWRRQZMRUZUINI-HSZRJFAPSA-N
External links
![]() 44432173 |
![]() CHEMBL232747 |
![]() 23294394 |
External search
|
|
|
|
|
Bibliography (1)
Pharmacological data
| Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|
| 0 | 1 | 0 | 0 |
Targets
| PPI family | Best activity | Diseases | MMoA |
|---|---|---|---|
| LFA / ICAM | 6.70 | immune system disease | Inhibition |
Physicochemical filters
| Descriptor | Lipinski's RO5 | Veber | Pfizer's 3/75 | |
|---|---|---|---|---|
| Compliance | ||||
| MW | 475.01 g/mol | |||
| HBA | 2 | |||
| HBD | 0 | |||
| HBA + HBD | 2 | |||
| AlogP | 6.36 | |||
| TPSA | 20.31 | |||
| RB | 4 |
Radar chart
PCA : iPPI-DB chemical space
PCA : Correlation circle
Efficiencies: iPPI-DB biplot LE versus LLE
Summary
| Bibliographic ressources | Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|---|
| 1 | 0 | 1 | 0 | 0 |
| Ta | Structure | Name | Drugbank ID |
|---|---|---|---|
| 0.7945 | 7A-[(4-cyanophenyl)methyl]-6-(3,5-dichlorophenyl)-5-oxo-2,3,5,7A-tetrahydro-1H-pyrrolo[1,2-A]pyrrole-7-carbonitrile | DB06972 | |
| 0.5454 | Arylacenamide | DB05792 | |
| 0.5068 | Imrecoxib | DB12354 | |
| 0.4832 | Cyclotheonamide A | DB04269 | |
| 0.4762 | (1S)-1-CYCLOPROPYL-2-[(2S)-4-(2,5-DIFLUOROPHENYL)-2-PHENYL-2,5-DIHYDRO-1H-PYRROL-1-YL]-2-OXOETHANAMINE | DB08244 | |
| 0.4741 | Pyrrobutamine | DB13846 | |
| 0.4559 | N-Caffeoyltyramine | DB08754 | |
| 0.4452 | SR 140333 | DB05790 | |
| 0.4402 | 4-bromo-2-{[(2R)-2-(2-chlorobenzyl)pyrrolidin-1-yl]carbonyl}aniline | DB08580 | |
| 0.4361 | Glutethimide | DB01437 | |
| 0.4354 | Xaliproden | DB06393 | |
| 0.4351 | Osanetant | DB04872 | |
| 0.4346 | Rocacetrapib | DB15437 | |
| 0.4296 | Dexetimide | DB08997 | |
| 0.4286 | 3-(1H-indol-3-yl)-4-(1-{2-[(2S)-1-methylpyrrolidinyl]ethyl}-1H-indol-3-yl)-1H-pyrrole-2,5-dione | DB07456 |




