Compound 844
Identifiers
- Canonical SMILES:
CN[C@@H](C)C(=O)N[C@@H](CO)C(=O)N1CC[C@@H]2[C@H]1[C@H](CN2C(C)=O)c1c[nH]c2cc(F)ccc12
- IUPAC name:
(2S)-N-[(2S)-1-[(3aR,6S,6aR)-4-acetyl-6-(6-fluoro-1H-indol-3-yl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]-3-hydroxy-1-oxopropan-2-yl]-2-(methylamino)propanamide
- InChi:
InChI=1S/C23H30FN5O4/c1-12(25-3)22(32)27-19(11-30)23(33)28-7-6-20-21(28)17(10-29(20)13(2)31)16-9-26-18-8-14(24)4-5-15(16)18/h4-5,8-9,12,17,19-21,25-26,30H,6-7,10-11H2,1-3H3,(H,27,32)/t12-,17+,19-,20+,21+/m0/s1
- InChiKey:
VNFFJLBYRHLXBO-PTIDVGSXSA-N
External links
![]() 45138261 |
External search
|
|
|
|
|
Bibliography (1)
| Publication | Name |
|---|---|
| Stephen M. Condon, Matthew G. Laporte, Tetralogic Pharmaceuticals Corp.. . Iap inhibitors None. | 63 |
Pharmacological data
| Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|
| 1 | 0 | 0 | 0 |
Targets
| PPI family | Best activity | Diseases | MMoA |
|---|---|---|---|
| XIAP / Smac | 7.00 | cancer | Inhibition |
Physicochemical filters
| Descriptor | Lipinski's RO5 | Veber | Pfizer's 3/75 | |
|---|---|---|---|---|
| Compliance | ||||
| MW | 459.23 g/mol | |||
| HBA | 9 | |||
| HBD | 4 | |||
| HBA + HBD | 13 | |||
| AlogP | -1.09 | |||
| TPSA | 117.77 | |||
| RB | 6 |
Radar chart
PCA : iPPI-DB chemical space
PCA : Correlation circle
Efficiencies: iPPI-DB biplot LE versus LLE
Summary
| Bibliographic ressources | Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|---|
| 1 | 1 | 0 | 0 | 0 |
Pharmacological data
| Bibliography | Name | Target | Competition | Assay type | Assay name | Cell line | Activity type | Activity |
|---|---|---|---|---|---|---|---|---|
| WO2010033531 | 63 | XIAP P98170 |
|
Biochemical assay | Fluorescence Polarization | pKd (dissociation constant, -log10) | 7.00 |
| Ta | Structure | Name | Drugbank ID |
|---|---|---|---|
| 0.8207 | Murepavadin | DB14777 | |
| 0.7945 | Somatoprim | DB12777 | |
| 0.7857 | Gramicidin D | DB00027 | |
| 0.7333 | Tifuvirtide | DB05413 | |
| 0.7290 | Anamorelin | DB06645 | |
| 0.7237 | BQ-123 | DB12054 | |
| 0.7123 | LTX-315 | DB12748 | |
| 0.7006 | Nerofe | DB14786 | |
| 0.6970 | Abarelix | DB00106 | |
| 0.6940 | Birinapant | DB11782 | |
| 0.6871 | Acyline | DB11906 | |
| 0.6867 | Oglufanide | DB05779 | |
| 0.6824 | Barusiban | DB12292 | |
| 0.6816 | Somatostatin | DB09099 | |
| 0.6802 | Edratide | DB15272 |




