Compound 837
Identifiers
- Canonical SMILES:
CN(C)CCCc1ccc(OCCCc2ccc(nc2C(O)=O)N2CCc3cccc(C(=O)Nc4nc5ccccc5s4)c3C2)c(F)c1
- IUPAC name:
6-[8-(1,3-benzothiazol-2-ylcarbamoyl)-3,4-dihydro-1H-isoquinolin-2-yl]-3-[3-[4-[3-(dimethylamino)propyl]-2-fluorophenoxy]propyl]pyridine-2-carboxylic acid
- InChi:
InChI=1S/C37H38FN5O4S/c1-42(2)19-6-8-24-14-16-31(29(38)22-24)47-21-7-10-26-15-17-33(40-34(26)36(45)46)43-20-18-25-9-5-11-27(28(25)23-43)35(44)41-37-39-30-12-3-4-13-32(30)48-37/h3-5,9,11-17,22H,6-8,10,18-21,23H2,1-2H3,(H,45,46)(H,39,41,44)
- InChiKey:
NACNDXYILJNIHK-UHFFFAOYSA-N
External links
![]() 46836989 |
External search
|
|
|
|
|
Bibliography (1)
Pharmacological data
| Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|
| 1 | 0 | 0 | 0 |
Targets
| PPI family | Best activity | Diseases | MMoA |
|---|---|---|---|
| BCL2-Like / BAX | 6.66 | cancer | Inhibition |
Physicochemical filters
| Descriptor | Lipinski's RO5 | Veber | Pfizer's 3/75 | |
|---|---|---|---|---|
| Compliance | ||||
| MW | 667.26 g/mol | |||
| HBA | 9 | |||
| HBD | 2 | |||
| HBA + HBD | 11 | |||
| AlogP | 5.48 | |||
| TPSA | 107.89 | |||
| RB | 13 |
Radar chart
PCA : iPPI-DB chemical space
PCA : Correlation circle
Efficiencies: iPPI-DB biplot LE versus LLE
Summary
| Bibliographic ressources | Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|---|
| 1 | 1 | 0 | 0 | 0 |
Pharmacological data
| Bibliography | Name | Target | Competition | Assay type | Assay name | Cell line | Activity type | Activity |
|---|---|---|---|---|---|---|---|---|
| WO2010080503 | 100 | BCL2 P10415 |
|
Biochemical assay | Time-Resolved FRET | pKi (inhibition constant, -log10) | 6.66 |
| Ta | Structure | Name | Drugbank ID |
|---|---|---|---|
| 0.5177 | (4R)-N-[4-({[2-(DIMETHYLAMINO)ETHYL]AMINO}CARBONYL)-1,3-THIAZOL-2-YL]-4-METHYL-1-OXO-2,3,4,9-TETRAHYDRO-1H-BETA-CARBOLINE-6-CARBOXAMIDE | DB07406 | |
| 0.4629 | MK-5108 | DB12556 | |
| 0.4449 | Talarozole | DB13083 | |
| 0.4412 | Ubrogepant | DB15328 | |
| 0.4407 | Selonsertib | DB14916 | |
| 0.4390 | MK-3207 | DB12424 | |
| 0.4385 | 4SC-203 | DB12669 | |
| 0.4261 | SJ-733 | DB12659 | |
| 0.4256 | Lumacaftor | DB09280 | |
| 0.4220 | JTK-853 | DB13095 | |
| 0.4209 | PF-00217830 | DB12998 | |
| 0.4182 | XV638 | DB02702 | |
| 0.4137 | INHIBITOR Q8467 OF DUPONT MERCK | DB04609 | |
| 0.4112 | Selitrectinib | DB14896 | |
| 0.4072 | AZD-5991 | DB14792 |




