Compound 836
Identifiers
- Canonical SMILES:
OCCC1CCN(CC1)c1cc(ccn1)-c1ccc(Sc2ccc3OCCOc3c2)c(c1)C(F)(F)F
- IUPAC name:
2-[1-[4-[4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)-3-(trifluoromethyl)phenyl]pyridin-2-yl]piperidin-4-yl]ethanol
- InChi:
InChI=1S/C27H27F3N2O3S/c28-27(29,30)22-15-19(1-4-25(22)36-21-2-3-23-24(17-21)35-14-13-34-23)20-5-9-31-26(16-20)32-10-6-18(7-11-32)8-12-33/h1-5,9,15-18,33H,6-8,10-14H2
- InChiKey:
ZMYOKTHPJKLGOG-UHFFFAOYSA-N
External links
![]() 21906760 |
![]() CHEMBL182877 |
![]() 10657264 |
External search
|
|
|
|
|
Bibliography (1)
Pharmacological data
| Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|
| 0 | 1 | 0 | 0 |
Targets
| PPI family | Best activity | Diseases | MMoA |
|---|---|---|---|
| LFA / ICAM | 6.88 | immune system disease | Inhibition |
Physicochemical filters
| Descriptor | Lipinski's RO5 | Veber | Pfizer's 3/75 | |
|---|---|---|---|---|
| Compliance | ||||
| MW | 516.17 g/mol | |||
| HBA | 5 | |||
| HBD | 1 | |||
| HBA + HBD | 6 | |||
| AlogP | 5.83 | |||
| TPSA | 54.82 | |||
| RB | 7 |
Radar chart
PCA : iPPI-DB chemical space
PCA : Correlation circle
Efficiencies: iPPI-DB biplot LE versus LLE
Summary
| Bibliographic ressources | Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|---|
| 1 | 0 | 1 | 0 | 0 |
| Ta | Structure | Name | Drugbank ID |
|---|---|---|---|
| 0.4813 | 1-Acetyl-4-(4-{4-[(2-Ethoxyphenyl)Thio]-3-Nitrophenyl}Pyridin-2-Yl)Piperazine | DB02177 | |
| 0.4530 | N-{2'-[(4-FLUOROPHENYL)AMINO]-4,4'-BIPYRIDIN-2-YL}-4-METHOXYCYCLOHEXANECARBOXAMIDE | DB08025 | |
| 0.4346 | ORM-13070 C-11 | DB15324 | |
| 0.4201 | Bitopertin | DB12426 | |
| 0.4167 | Netupitant | DB09048 | |
| 0.4083 | ETHYL 4-[(4-METHYLPYRIDIN-2-YL)AMINO]PIPERIDINE-1-CARBOXYLATE | DB07388 | |
| 0.4062 | 3-[3-(4-methylpiperazin-1-yl)-7-(trifluoromethyl)quinoxalin-5-yl]phenol | DB07969 | |
| 0.4044 | 4-({4-[(4-methoxypyridin-2-yl)amino]piperidin-1-yl}carbonyl)benzonitrile | DB07002 | |
| 0.4043 | Dorsomorphin | DB08597 | |
| 0.4034 | Periciazine | DB01608 | |
| 0.4010 | Lecozotan | DB12540 | |
| 0.3980 | Neladenoson bialanate | DB13138 | |
| 0.3971 | E-6005 | DB12776 | |
| 0.3962 | AZD-4017 | DB14875 | |
| 0.3958 | Ozenoxacin | DB12924 |




