Compound 830
Identifiers
- Canonical SMILES:
CN([C@@H]1CCN(C1)c1cc(ccn1)-c1ccc(Sc2ccc3OCCOc3c2)c(c1)C(F)(F)F)C(C)=O
- IUPAC name:
N-[(3R)-1-[4-[4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)-3-(trifluoromethyl)phenyl]pyridin-2-yl]pyrrolidin-3-yl]-N-methylacetamide
- InChi:
InChI=1S/C27H26F3N3O3S/c1-17(34)32(2)20-8-10-33(16-20)26-14-19(7-9-31-26)18-3-6-25(22(13-18)27(28,29)30)37-21-4-5-23-24(15-21)36-12-11-35-23/h3-7,9,13-15,20H,8,10-12,16H2,1-2H3/t20-/m1/s1
- InChiKey:
VWDMVVKQHNPLEH-HXUWFJFHSA-N
External links
![]() 44391969 |
![]() CHEMBL180486 |
![]() 23248053 |
External search
|
|
|
|
|
Bibliography (1)
Pharmacological data
| Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|
| 0 | 1 | 0 | 0 |
Targets
| PPI family | Best activity | Diseases | MMoA |
|---|---|---|---|
| LFA / ICAM | 6.77 | immune system disease | Inhibition |
Physicochemical filters
| Descriptor | Lipinski's RO5 | Veber | Pfizer's 3/75 | |
|---|---|---|---|---|
| Compliance | ||||
| MW | 529.16 g/mol | |||
| HBA | 6 | |||
| HBD | 0 | |||
| HBA + HBD | 6 | |||
| AlogP | 4.88 | |||
| TPSA | 54.90 | |||
| RB | 6 |
Radar chart
PCA : iPPI-DB chemical space
PCA : Correlation circle
Efficiencies: iPPI-DB biplot LE versus LLE
Summary
| Bibliographic ressources | Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|---|
| 1 | 0 | 1 | 0 | 0 |
| Ta | Structure | Name | Drugbank ID |
|---|---|---|---|
| 0.5838 | 1-Acetyl-4-(4-{4-[(2-Ethoxyphenyl)Thio]-3-Nitrophenyl}Pyridin-2-Yl)Piperazine | DB02177 | |
| 0.4951 | Netupitant | DB09048 | |
| 0.4932 | Bitopertin | DB12426 | |
| 0.4854 | Lecozotan | DB12540 | |
| 0.4721 | ORM-13070 C-11 | DB15324 | |
| 0.4658 | Fosnetupitant | DB14019 | |
| 0.4444 | 3-[3-(4-methylpiperazin-1-yl)-7-(trifluoromethyl)quinoxalin-5-yl]phenol | DB07969 | |
| 0.4350 | SB-705498 | DB11883 | |
| 0.4270 | ETHYL 4-[(4-METHYLPYRIDIN-2-YL)AMINO]PIPERIDINE-1-CARBOXYLATE | DB07388 | |
| 0.4219 | 4-({4-[(4-methoxypyridin-2-yl)amino]piperidin-1-yl}carbonyl)benzonitrile | DB07002 | |
| 0.4210 | 1-[2-HYDROXY-3-(4-CYCLOHEXYL-PHENOXY)-PROPYL]-4-(2-PYRIDYL)-PIPERAZINE | DB08543 | |
| 0.4196 | ALK-4290 | DB15269 | |
| 0.4091 | N-{2'-[(4-FLUOROPHENYL)AMINO]-4,4'-BIPYRIDIN-2-YL}-4-METHOXYCYCLOHEXANECARBOXAMIDE | DB08025 | |
| 0.4072 | Blonanserin | DB09223 | |
| 0.4046 | Neladenoson bialanate | DB13138 |




