Compound 826
Identifiers
- Canonical SMILES:
OC[C@H]1CN(CCN1C(=O)C(=O)c1c[nH]c2cccc(F)c12)C(=O)c1ccccc1
- IUPAC name:
1-[4-benzoyl-2-(hydroxymethyl)piperazin-1-yl]-2-(4-fluoro-1H-indol-3-yl)ethane-1,2-dione
- InChi:
InChI=1S/C22H20FN3O4/c23-17-7-4-8-18-19(17)16(11-24-18)20(28)22(30)26-10-9-25(12-15(26)13-27)21(29)14-5-2-1-3-6-14/h1-8,11,15,24,27H,9-10,12-13H2/t15-/m1/s1
- InChiKey:
FBQCBTJQCZMGMN-OAHLLOKOSA-N
External links
![]() 168318066 |
![]() 442125 |
External search
|
|
|
|
|
Bibliography (1)
Pharmacological data
| Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|
| 0 | 1 | 0 | 0 |
Targets
| PPI family | Best activity | Diseases | MMoA |
|---|---|---|---|
| CD4 / gp120 | 6.19 | HIV infectious disease | Inhibition |
Physicochemical filters
| Descriptor | Lipinski's RO5 | Veber | Pfizer's 3/75 | |
|---|---|---|---|---|
| Compliance | ||||
| MW | 409.14 g/mol | |||
| HBA | 7 | |||
| HBD | 2 | |||
| HBA + HBD | 9 | |||
| AlogP | 1.67 | |||
| TPSA | 93.71 | |||
| RB | 4 |
Radar chart
PCA : iPPI-DB chemical space
PCA : Correlation circle
Efficiencies: iPPI-DB biplot LE versus LLE
Summary
| Bibliographic ressources | Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|---|
| 1 | 0 | 1 | 0 | 0 |
| Ta | Structure | Name | Drugbank ID |
|---|---|---|---|
| 0.6398 | Talmapimod | DB05412 | |
| 0.6336 | N-[1H-INDOL-3-YL-ACETYL]GLYCINE ACID | DB07952 | |
| 0.6296 | N-[1H-INDOL-3-YL-ACETYL]VALINE ACID | DB07953 | |
| 0.6268 | N-(indole-3-acetyl)-L-aspartic acid | DB07951 | |
| 0.5909 | Gramicidin D | DB00027 | |
| 0.5890 | Murepavadin | DB14777 | |
| 0.5864 | Somatoprim | DB12777 | |
| 0.5743 | LY-517717 | DB05713 | |
| 0.5667 | Pruvanserin | DB13094 | |
| 0.5598 | Oglufanide | DB05779 | |
| 0.5482 | BQ-123 | DB12054 | |
| 0.5404 | Birinapant | DB11782 | |
| 0.5379 | 4-Fluorotryptophane | DB03386 | |
| 0.5347 | Indoramin | DB08950 | |
| 0.5341 | Acyline | DB11906 |




