Compound 817
Identifiers
- Canonical SMILES:
CN(C)CC[C@H](CSc1ccccc1)Nc1ccc(cc1S(=O)(=O)C(F)(F)F)S(=O)(=O)Nc1ncnc2CN(CCc12)[C@H]1CC[C@@](O)(Cc2ccccc2-c2ccc(Cl)cc2)CC1
- InChi:
InChI=1S/C45H50ClF3N6O5S3/c1-54(2)24-20-34(29-61-36-9-4-3-5-10-36)52-40-17-16-37(26-42(40)62(57,58)45(47,48)49)63(59,60)53-43-39-21-25-55(28-41(39)50-30-51-43)35-18-22-44(56,23-19-35)27-32-8-6-7-11-38(32)31-12-14-33(46)15-13-31/h3-17,26,30,34-35,52,56H,18-25,27-29H2,1-2H3,(H,50,51,53)/t34-,35-,44-/m1/s1
- InChiKey:
BYJHWFAOZXGAHA-DGHVKXBUSA-N
External search
![]() |
![]() |
![]() |
![]() |
![]() |
Bibliography (1)
Publication | Name |
---|---|
Karen Miller-Moslin, Bakary-Barry Toure, Michael Scott Visser, Naeem Yusuff, Novartis Ag. . Sulfonamides as inhibitors of bcl-2 family proteins for the treatment of cancer None. | 64 |
Pharmacological data
Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
---|---|---|---|
1 | 0 | 0 | 0 |
Targets
PPI family | Best activity | Diseases | MMoA |
---|---|---|---|
BCL2-Like / BAX | 7.15 | cancer | Inhibition |
Physicochemical filters
Descriptor | Lipinski's RO5 | Veber | Pfizer's 3/75 | |
---|---|---|---|---|
Compliance | ||||
MW | 942.26 g/mol | |||
HBA | 11 | |||
HBD | 3 | |||
HBA + HBD | 14 | |||
AlogP | 7.58 | |||
TPSA | 144.83 | |||
RB | 16 |
Radar chart
PCA : iPPI-DB chemical space
PCA : Correlation circle
Efficiencies: iPPI-DB biplot LE versus LLE
Summary
Bibliographic ressources | Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
---|---|---|---|---|
1 | 1 | 0 | 0 | 0 |
Pharmacological data
Bibliography | Name | Target | Competition | Assay type | Assay name | Cell line | Activity type | Activity |
---|---|---|---|---|---|---|---|---|
WO2011029842 | 64 | BCL2 P10415 |
|
Biochemical assay | Surface Plasmon Resonance | pIC50 (half maximal inhibitory concentration, -log10) | 7.15 |
Ta | Structure | Name | Drugbank ID |
---|---|---|---|
0.5047 | Navitoclax | DB12340 | |
0.3854 | N-{2-[6-(2,4-DIAMINO-6-ETHYLPYRIMIDIN-5-YL)-2,2-DIMETHYL-3-OXO-2,3-DIHYDRO-4H-1,4-BENZOTHIAZIN-4-YL]ETHYL}ACETAMIDE | DB06899 | |
0.3806 | GDC-0349 | DB13072 | |
0.3775 | Quinupristin | DB01369 | |
0.3704 | Tianeptine | DB09289 | |
0.3699 | Presatovir | DB12165 | |
0.3682 | Sulfaisodimidine | DB13283 | |
0.3676 | Vintafolide | DB05168 | |
0.3666 | PF-232798 | DB14813 | |
0.3643 | 5-(5-chloro-7H-pyrrolo[2,3-d]pyrimidin-4-yl)-4,5,6,7-tetrahydro-1H-imidazo[4,5-c]pyridine | DB07585 | |
0.3639 | BMS-214662 | DB12234 | |
0.3581 | Metoserpate | DB11530 | |
0.3559 | Lenacapavir | DB15673 | |
0.3545 | Venetoclax | DB11581 | |
0.3540 | Rivipansel | DB12778 |