Compound 816
Identifiers
- Canonical SMILES:
CNC(=O)c1cc(OC)c(O[C@@H](C)C(=O)N2CCN(C[C@H]2C)c2nccc3[nH]ncc23)cn1
- IUPAC name:
4-methoxy-N-methyl-5-[(2S)-1-[(2R)-2-methyl-4-(1H-pyrazolo[4,3-c]pyridin-4-yl)piperazin-1-yl]-1-oxopropan-2-yl]oxypyridine-2-carboxamide
- InChi:
InChI=1S/C22H27N7O4/c1-13-12-28(20-15-10-26-27-16(15)5-6-24-20)7-8-29(13)22(31)14(2)33-19-11-25-17(21(30)23-3)9-18(19)32-4/h5-6,9-11,13-14H,7-8,12H2,1-4H3,(H,23,30)(H,26,27)/t13-,14+/m1/s1
- InChiKey:
CMKHEDIXVQQCOC-KGLIPLIRSA-N
External links
![]() 45487381 |
![]() CHEMBL566450 |
![]() 24631774 |
External search
|
|
|
|
|
Bibliography (1)
Pharmacological data
| Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|
| 0 | 1 | 0 | 0 |
Targets
| PPI family | Best activity | Diseases | MMoA |
|---|---|---|---|
| CD4 / gp120 | 7.62 | HIV infectious disease | Inhibition |
Physicochemical filters
| Descriptor | Lipinski's RO5 | Veber | Pfizer's 3/75 | |
|---|---|---|---|---|
| Compliance | ||||
| MW | 453.21 g/mol | |||
| HBA | 11 | |||
| HBD | 2 | |||
| HBA + HBD | 13 | |||
| AlogP | 0.00 | |||
| TPSA | 125.57 | |||
| RB | 6 |
Radar chart
PCA : iPPI-DB chemical space
PCA : Correlation circle
Efficiencies: iPPI-DB biplot LE versus LLE
Summary
| Bibliographic ressources | Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|---|
| 1 | 0 | 1 | 0 | 0 |
| Ta | Structure | Name | Drugbank ID |
|---|---|---|---|
| 0.5487 | Atevirdine | DB12264 | |
| 0.4953 | Lecozotan | DB12540 | |
| 0.4750 | USL-311 | DB15265 | |
| 0.4689 | Delavirdine | DB00705 | |
| 0.4619 | Doxazosin | DB00590 | |
| 0.4612 | ORM-13070 C-11 | DB15324 | |
| 0.4576 | Tamatinib | DB07159 | |
| 0.4465 | 4-[[2-[[4-chloro-3-(trifluoromethyl)phenyl]amino]-3H-benzimidazol-5-yl]oxy]-N-methyl-pyridine-2-carboxamide | DB06938 | |
| 0.4390 | Vesnarinone | DB12082 | |
| 0.4378 | E-6005 | DB12776 | |
| 0.4335 | CM-4307 | DB15414 | |
| 0.4335 | Sorafenib | DB00398 | |
| 0.4292 | Sonidegib | DB09143 | |
| 0.4280 | N-{2-[6-(2,4-DIAMINO-6-ETHYLPYRIMIDIN-5-YL)-2,2-DIMETHYL-3-OXO-2,3-DIHYDRO-4H-1,4-BENZOXAZIN-4-YL]ETHYL}ACETAMIDE | DB07059 | |
| 0.4272 | Regorafenib | DB08896 |




