Compound 689
Identifiers
- Canonical SMILES:
C(Cc1c[nH]c2ccccc12)Nc1ccc(Nc2ccncc2)c2ccccc12
- IUPAC name:
1-N-[2-(1H-indol-3-yl)ethyl]-4-N-pyridin-4-ylnaphthalene-1,4-diamine
- InChi:
InChI=1S/C25H22N4/c1-2-7-22-21(6-1)24(9-10-25(22)29-19-12-14-26-15-13-19)27-16-11-18-17-28-23-8-4-3-5-20(18)23/h1-10,12-15,17,27-28H,11,16H2,(H,26,29)
- InChiKey:
KSAOWOZEVGCRBQ-UHFFFAOYSA-N
External links
59493270 |
External search
Bibliography (1)
Publication | Name |
---|---|
Virginie Sophie Poncelet, Sophie Coupa, Pierre-Henri Storck, Bruno Schoentjes, Janssen Pharmaceutica Nv. . Inhibitors of the interaction between mdm2 and p53 None. | 6 |
Pharmacological data
Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
---|---|---|---|
1 | 0 | 0 | 0 |
Targets
PPI family | Best activity | Diseases | MMoA |
---|---|---|---|
MDM2-Like / P53 | 6.00 | cancer | Inhibition |
Physicochemical filters
Descriptor | Lipinski's RO5 | Veber | Pfizer's 3/75 | |
---|---|---|---|---|
Compliance | ||||
MW | 378.18 g/mol | |||
HBA | 4 | |||
HBD | 3 | |||
HBA + HBD | 7 | |||
AlogP | 4.77 | |||
TPSA | 52.74 | |||
RB | 6 |
Radar chart
PCA : iPPI-DB chemical space
PCA : Correlation circle
Efficiencies: iPPI-DB biplot LE versus LLE
Summary
Bibliographic ressources | Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
---|---|---|---|---|
1 | 1 | 0 | 0 | 0 |
Pharmacological data
Bibliography | Name | Target | Competition | Assay type | Assay name | Cell line | Activity type | Activity |
---|---|---|---|---|---|---|---|---|
WO2009037308 | 6 | MDM2 Q00987 |
|
Biochemical assay | ELISA | pIC50 (half maximal inhibitory concentration, -log10) | 6.00 |
Ta | Structure | Name | Drugbank ID |
---|---|---|---|
1.0000 | Serdemetan | DB12027 | |
0.7436 | Dimethyltryptamine | DB01488 | |
0.7160 | Diethyltryptamine | DB01460 | |
0.6795 | Tryptamine | DB08653 | |
0.6591 | Bufotenine | DB01445 | |
0.6429 | Indopan | DB01446 | |
0.6170 | 5-methoxy-N,N-dimethyltryptamine | DB14010 | |
0.6146 | N-acetylserotonin | DB04275 | |
0.6136 | Etryptamine | DB01546 | |
0.6105 | Dipropyl-4-hydroxytryptamine | DB13990 | |
0.6042 | 5-Methoxy-N,N-diisopropyltryptamine | DB01441 | |
0.6023 | (1S)-1-AMINO-2-(1H-INDOL-3-YL)ETHANOL | DB08649 | |
0.6023 | Indoleacetamide | DB08652 | |
0.6023 | Serotonin | DB08839 | |
0.5934 | 2-Amino-3-(1h-Indol-3-Yl)-Propan-1-Ol | DB04236 |