Compound 656
Identifiers
- Canonical SMILES:
CC(C)(C)C[C@H]1N[C@H]([C@H](c2ccc(F)c(Cl)c2)[C@@]11C(=O)Nc2cc(Cl)c(F)cc12)C(=O)NCCn1ccnc1
- IUPAC name:
(2'R,3S,3'R,5'R)-6-chloro-3'-(3-chloro-4-fluorophenyl)-5'-(2,2-dimethylpropyl)-5-fluoro-N-(2-imidazol-1-ylethyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxamide
- InChi:
InChI=1S/C28H29Cl2F2N5O2/c1-27(2,3)13-22-28(16-11-20(32)18(30)12-21(16)35-26(28)39)23(15-4-5-19(31)17(29)10-15)24(36-22)25(38)34-7-9-37-8-6-33-14-37/h4-6,8,10-12,14,22-24,36H,7,9,13H2,1-3H3,(H,34,38)(H,35,39)/t22-,23+,24-,28+/m1/s1
- InChiKey:
UDNSTTYXSFSVNA-PVIBPIFHSA-N
External links
59343750 |
External search
Bibliography (1)
Publication | Name |
---|---|
Shaomeng Wang, Dongguang Qin, Jianyong Chen, Shanghai Yu, The Regents Of The University Of Michigan. . New small molecule inhibitors of mdm2 and the uses thereof None. | 319-17 |
Pharmacological data
Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
---|---|---|---|
1 | 3 | 0 | 0 |
Targets
PPI family | Best activity | Diseases | MMoA |
---|---|---|---|
MDM2-Like / P53 | 6.41 | cancer | Inhibition |
Physicochemical filters
Descriptor | Lipinski's RO5 | Veber | Pfizer's 3/75 | |
---|---|---|---|---|
Compliance | ||||
MW | 575.17 g/mol | |||
HBA | 7 | |||
HBD | 3 | |||
HBA + HBD | 10 | |||
AlogP | 4.72 | |||
TPSA | 88.05 | |||
RB | 7 |
Radar chart
PCA : iPPI-DB chemical space
PCA : Correlation circle
Efficiencies: iPPI-DB biplot LE versus LLE
Summary
Bibliographic ressources | Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
---|---|---|---|---|
1 | 1 | 3 | 0 | 0 |
Pharmacological data
Bibliography | Name | Target | Competition | Assay type | Assay name | Cell line | Activity type | Activity |
---|---|---|---|---|---|---|---|---|
WO2008036168 | 319-17 | MDM2 Q00987 |
|
Biochemical assay | Fluorescence Polarization | pIC50 (half maximal inhibitory concentration, -log10) | 6.41 | |
WO2008036168 | 319-17 | MDM2 Q00987 |
|
Cellular assay | Proliferation assay | LNCaP cells | pIC50 (half maximal inhibitory concentration, -log10) | 5.96 |
WO2008036168 | 319-17 | MDM2 Q00987 |
|
Cellular assay | Proliferation assay | HCT-116 cells p53WT | pIC50 (half maximal inhibitory concentration, -log10) | 5.68 |
WO2008036168 | 319-17 | MDM2 Q00987 |
|
Cellular assay | Proliferation assay | PC-3 cells | pIC50 (half maximal inhibitory concentration, -log10) | 4.85 |
Ta | Structure | Name | Drugbank ID |
---|---|---|---|
0.7812 | SAR-405838 | DB12541 | |
0.6410 | Milademetan | DB15257 | |
0.5211 | Nirogacestat | DB12005 | |
0.5063 | MK-3207 | DB12424 | |
0.5022 | Degarelix | DB06699 | |
0.4928 | SLV-334 | DB15356 | |
0.4925 | Mosapramine | DB13676 | |
0.4915 | Idasanutlin | DB12325 | |
0.4789 | Daglutril | DB05796 | |
0.4781 | SOR-C13 | DB15366 | |
0.4748 | N-({4-[4-(2-Methyl-1H-imidazol-1-yl)butyl]phenyl}acetyl)-L-seryl-N-(2-cyclohexylethyl)-L-lysinamide | DB02477 | |
0.4694 | Cotadutide | DB15194 | |
0.4657 | Ezetimibe | DB00973 | |
0.4654 | Acyline | DB11906 | |
0.4653 | Taspoglutide | DB14027 |