Compound 645
Identifiers
- Canonical SMILES:
CC[C@@H](O)CCNC(=O)[C@@H]1N[C@H](C2CCCC2)[C@@]2([C@H]1c1ccc(F)c(Cl)c1)C(=O)Nc1cc(Cl)c(F)cc21
- InChi:
InChI=1S/C28H31Cl2F2N3O3/c1-2-16(36)9-10-33-26(37)24-23(15-7-8-20(31)18(29)11-15)28(25(35-24)14-5-3-4-6-14)17-12-21(32)19(30)13-22(17)34-27(28)38/h7-8,11-14,16,23-25,35-36H,2-6,9-10H2,1H3,(H,33,37)(H,34,38)/t16-,23+,24-,25-,28-/m1/s1
- InChiKey:
IIMMPSUMBXQAKL-IFEKXBSVSA-N
External links
![]() 168318152 |
External search
|
|
|
|
|
Bibliography (1)
| Publication | Name |
|---|---|
| Shaomeng Wang, Dongguang Qin, Jianyong Chen, Shanghai Yu, The Regents Of The University Of Michigan. . New small molecule inhibitors of mdm2 and the uses thereof None. | 319-8 |
Pharmacological data
| Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|
| 1 | 3 | 0 | 0 |
Targets
| PPI family | Best activity | Diseases | MMoA |
|---|---|---|---|
| MDM2-Like / P53 | 6.47 | cancer | Inhibition |
Physicochemical filters
| Descriptor | Lipinski's RO5 | Veber | Pfizer's 3/75 | |
|---|---|---|---|---|
| Compliance | ||||
| MW | 565.17 g/mol | |||
| HBA | 6 | |||
| HBD | 4 | |||
| HBA + HBD | 10 | |||
| AlogP | 4.88 | |||
| TPSA | 90.46 | |||
| RB | 7 |
Radar chart
PCA : iPPI-DB chemical space
PCA : Correlation circle
Efficiencies: iPPI-DB biplot LE versus LLE
Summary
| Bibliographic ressources | Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|---|
| 1 | 1 | 3 | 0 | 0 |
Pharmacological data
| Bibliography | Name | Target | Competition | Assay type | Assay name | Cell line | Activity type | Activity |
|---|---|---|---|---|---|---|---|---|
| WO2008036168 | 319-8 | MDM2 Q00987 |
|
Biochemical assay | Fluorescence Polarization | pIC50 (half maximal inhibitory concentration, -log10) | 6.47 | |
| WO2008036168 | 319-8 | MDM2 Q00987 |
|
Cellular assay | Proliferation assay | LNCaP cells | pIC50 (half maximal inhibitory concentration, -log10) | 6.02 |
| WO2008036168 | 319-8 | MDM2 Q00987 |
|
Cellular assay | Proliferation assay | HCT-116 cells p53WT | pIC50 (half maximal inhibitory concentration, -log10) | 5.39 |
| WO2008036168 | 319-8 | MDM2 Q00987 |
|
Cellular assay | Proliferation assay | PC-3 cells | pIC50 (half maximal inhibitory concentration, -log10) | 4.67 |
| Ta | Structure | Name | Drugbank ID |
|---|---|---|---|
| 0.8371 | SAR-405838 | DB12541 | |
| 0.6622 | Milademetan | DB15257 | |
| 0.5367 | Degarelix | DB06699 | |
| 0.5323 | Mosapramine | DB13676 | |
| 0.5312 | SLV-334 | DB15356 | |
| 0.5152 | Daglutril | DB05796 | |
| 0.5150 | Acyline | DB11906 | |
| 0.5133 | MK-3207 | DB12424 | |
| 0.5112 | Idasanutlin | DB12325 | |
| 0.5098 | Abarelix | DB00106 | |
| 0.5060 | (3S)-N-(3-CHLORO-2-METHYLPHENYL)-1-CYCLOHEXYL-5-OXOPYRROLIDINE-3-CARBOXAMIDE | DB07090 | |
| 0.5060 | (3S)-N-(5-CHLORO-2-METHYLPHENYL)-1-CYCLOHEXYL-5-OXOPYRROLIDINE-3-CARBOXAMIDE | DB07222 | |
| 0.5000 | OPC-51803 | DB05838 | |
| 0.4948 | OPC-14523 | DB05422 | |
| 0.4921 | Lumateperone | DB06077 |




