Compound 57
Identifiers
- Canonical SMILES:
C[C@H]1C[C@H](CCN1CC1=C(CC(C)(C)CC1)c1ccc(Cl)cc1)N1CCc2c(C1)ncnc2NS(=O)(=O)c1ccc(N[C@H](CCN2CCOCC2)CSc2ccccc2)c(c1)S(=O)(=O)C(F)(F)F
- InChi:
InChI=1S/C49H61ClF3N7O5S3/c1-34-27-39(17-21-59(34)30-36-15-19-48(2,3)29-43(36)35-9-11-37(50)12-10-35)60-22-18-42-45(31-60)54-33-55-47(42)57-68(63,64)41-13-14-44(46(28-41)67(61,62)49(51,52)53)56-38(16-20-58-23-25-65-26-24-58)32-66-40-7-5-4-6-8-40/h4-14,28,33-34,38-39,56H,15-27,29-32H2,1-3H3,(H,54,55,57)/t34-,38+,39-/m0/s1
- InChiKey:
FVPJABXVEBVSTQ-ZFKVFEFPSA-N
External links
![]() 168318281 |
External search
|
|
|
|
|
Bibliography (1)
| Publication | Name |
|---|---|
| Karen Miller-Moslin, Bakary-Barry Toure, Michael Scott Visser, Naeem Yusuff, Novartis Ag. . Sulfonamides as inhibitors of bcl-2 family proteins for the treatment of cancer None. | 27 |
Pharmacological data
| Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|
| 1 | 0 | 0 | 0 |
Targets
| PPI family | Best activity | Diseases | MMoA |
|---|---|---|---|
| BCL2-Like / BAX | 6.69 | cancer | Inhibition |
Physicochemical filters
| Descriptor | Lipinski's RO5 | Veber | Pfizer's 3/75 | |
|---|---|---|---|---|
| Compliance | ||||
| MW | 1015.35 g/mol | |||
| HBA | 12 | |||
| HBD | 2 | |||
| HBA + HBD | 14 | |||
| AlogP | 7.32 | |||
| TPSA | 137.07 | |||
| RB | 16 |
Radar chart
PCA : iPPI-DB chemical space
PCA : Correlation circle
Efficiencies: iPPI-DB biplot LE versus LLE
Summary
| Bibliographic ressources | Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|---|
| 1 | 1 | 0 | 0 | 0 |
Pharmacological data
| Bibliography | Name | Target | Competition | Assay type | Assay name | Cell line | Activity type | Activity |
|---|---|---|---|---|---|---|---|---|
| WO2011029842 | 27 | BCL2 P10415 |
|
Biochemical assay | Surface Plasmon Resonance | pIC50 (half maximal inhibitory concentration, -log10) | 6.69 |
| Ta | Structure | Name | Drugbank ID |
|---|---|---|---|
| 0.6557 | Navitoclax | DB12340 | |
| 0.4316 | Venetoclax | DB11581 | |
| 0.3889 | Quinupristin | DB01369 | |
| 0.3855 | Henatinib | DB13019 | |
| 0.3846 | GDC-0349 | DB13072 | |
| 0.3740 | Presatovir | DB12165 | |
| 0.3724 | (3Z)-N,N-DIMETHYL-2-OXO-3-(4,5,6,7-TETRAHYDRO-1H-INDOL-2-YLMETHYLIDENE)-2,3-DIHYDRO-1H-INDOLE-5-SULFONAMIDE | DB08039 | |
| 0.3705 | Vintafolide | DB05168 | |
| 0.3607 | Lurbinectedin | DB12674 | |
| 0.3603 | TMC-647055 | DB11822 | |
| 0.3589 | Vinpocetine | DB12131 | |
| 0.3570 | Bleomycin | DB00290 | |
| 0.3566 | Satavaptan | DB14923 | |
| 0.3565 | (4aS)-5-[(2,4-diaminopteridin-6-yl)methyl]-4a,5-dihydro-2H-dibenzo[b,f]azepin-8-ol | DB08448 | |
| 0.3546 | Deacetoxyvinzolidine | DB02868 |




