Compound 560
Identifiers
- Canonical SMILES:
CC(C)(C)C[C@H]1N[C@H]([C@H](c2ccc(F)c(Cl)c2)[C@@]11C(=O)Nc2cc(Cl)c(F)cc12)C(=O)N1CCN(CCO)CC1
- IUPAC name:
(2'R,3S,4'R,5'R)-6-chloro-4'-(3-chloro-4-fluorophenyl)-2'-(2,2-dimethylpropyl)-5-fluoro-5'-[4-(2-hydroxyethyl)piperazine-1-carbonyl]spiro[1H-indole-3,3'-pyrrolidine]-2-one
- InChi:
InChI=1S/C29H34Cl2F2N4O3/c1-28(2,3)15-23-29(17-13-21(33)19(31)14-22(17)34-27(29)40)24(16-4-5-20(32)18(30)12-16)25(35-23)26(39)37-8-6-36(7-9-37)10-11-38/h4-5,12-14,23-25,35,38H,6-11,15H2,1-3H3,(H,34,40)/t23-,24+,25-,29+/m1/s1
- InChiKey:
AHOPQGMIYDQMDU-ZTVFFDQVSA-N
External links
![]() 25000808 |
External search
|
|
|
|
|
Bibliography (1)
| Publication | Name |
|---|---|
| Shaomeng Wang, Dongguang Qin, Jianyong Chen, Shanghai Yu, The Regents Of The University Of Michigan. . New small molecule inhibitors of mdm2 and the uses thereof None. | 319-12 |
Pharmacological data
| Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|
| 1 | 3 | 0 | 0 |
Targets
| PPI family | Best activity | Diseases | MMoA |
|---|---|---|---|
| MDM2-Like / P53 | 5.71 | cancer | Inhibition |
Physicochemical filters
| Descriptor | Lipinski's RO5 | Veber | Pfizer's 3/75 | |
|---|---|---|---|---|
| Compliance | ||||
| MW | 594.20 g/mol | |||
| HBA | 7 | |||
| HBD | 3 | |||
| HBA + HBD | 10 | |||
| AlogP | 4.19 | |||
| TPSA | 84.91 | |||
| RB | 6 |
Radar chart
PCA : iPPI-DB chemical space
PCA : Correlation circle
Efficiencies: iPPI-DB biplot LE versus LLE
Summary
| Bibliographic ressources | Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|---|
| 1 | 1 | 3 | 0 | 0 |
Pharmacological data
| Bibliography | Name | Target | Competition | Assay type | Assay name | Cell line | Activity type | Activity |
|---|---|---|---|---|---|---|---|---|
| WO2008036168 | 319-12 | MDM2 Q00987 |
|
Biochemical assay | Fluorescence Polarization | pIC50 (half maximal inhibitory concentration, -log10) | 5.64 | |
| WO2008036168 | 319-12 | MDM2 Q00987 |
|
Cellular assay | Proliferation assay | LNCaP cells | pIC50 (half maximal inhibitory concentration, -log10) | 5.71 |
| WO2008036168 | 319-12 | MDM2 Q00987 |
|
Cellular assay | Proliferation assay | HCT-116 cells p53WT | pIC50 (half maximal inhibitory concentration, -log10) | 4.91 |
| WO2008036168 | 319-12 | MDM2 Q00987 |
|
Cellular assay | Proliferation assay | PC-3 cells | pIC50 (half maximal inhibitory concentration, -log10) | 4.65 |
| Ta | Structure | Name | Drugbank ID |
|---|---|---|---|
| 0.8022 | SAR-405838 | DB12541 | |
| 0.6667 | Milademetan | DB15257 | |
| 0.5445 | SLV-334 | DB15356 | |
| 0.5413 | Degarelix | DB06699 | |
| 0.5312 | MK-3207 | DB12424 | |
| 0.5279 | Daglutril | DB05796 | |
| 0.5200 | Acyline | DB11906 | |
| 0.5147 | Abarelix | DB00106 | |
| 0.5132 | Mosapramine | DB13676 | |
| 0.5089 | Idasanutlin | DB12325 | |
| 0.5027 | Benazeprilat | DB14125 | |
| 0.5000 | Diamino-N-[(4S)-5-anilino-4-{[(2S)-2-{[(1R)-1-carboxyethyl]amino}-4-phenylbutanoyl]amino}-5-oxopentyl]methaniminium | DB02747 | |
| 0.5000 | 3-[4-(1-formylpiperazin-4-yl)-benzylidenyl]-2-indolinone | DB02058 | |
| 0.4922 | OPC-14523 | DB05422 | |
| 0.4895 | Lumateperone | DB06077 |




