Compound 545
Identifiers
- Canonical SMILES:
COc1ccc2c(CCNc3c(Cl)cc(Nc4ccnc5ccccc45)cc3Cl)c[nH]c2c1
- IUPAC name:
2,6-dichloro-1-N-[2-(6-methoxy-1H-indol-3-yl)ethyl]-4-N-quinolin-4-ylbenzene-1,4-diamine
- InChi:
InChI=1S/C26H22Cl2N4O/c1-33-18-6-7-19-16(15-31-25(19)14-18)8-10-30-26-21(27)12-17(13-22(26)28)32-24-9-11-29-23-5-3-2-4-20(23)24/h2-7,9,11-15,30-31H,8,10H2,1H3,(H,29,32)
- InChiKey:
JHGJHKQKFNACAP-UHFFFAOYSA-N
External links
![]() 59493259 |
External search
![]() |
![]() |
![]() |
![]() |
![]() |
Bibliography (1)
Publication | Name |
---|---|
Virginie Sophie Poncelet, Sophie Coupa, Pierre-Henri Storck, Bruno Schoentjes, Janssen Pharmaceutica Nv. . Inhibitors of the interaction between mdm2 and p53 None. | 31 |
Pharmacological data
Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
---|---|---|---|
1 | 1 | 0 | 0 |
Targets
PPI family | Best activity | Diseases | MMoA |
---|---|---|---|
MDM2-Like / P53 | 6.00 | cancer | Inhibition |
Physicochemical filters
Descriptor | Lipinski's RO5 | Veber | Pfizer's 3/75 | |
---|---|---|---|---|
Compliance | ||||
MW | 476.12 g/mol | |||
HBA | 5 | |||
HBD | 3 | |||
HBA + HBD | 8 | |||
AlogP | 6.21 | |||
TPSA | 61.97 | |||
RB | 7 |
Radar chart
PCA : iPPI-DB chemical space
PCA : Correlation circle
Efficiencies: iPPI-DB biplot LE versus LLE
Summary
Bibliographic ressources | Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
---|---|---|---|---|
1 | 1 | 1 | 0 | 0 |
Pharmacological data
Bibliography | Name | Target | Competition | Assay type | Assay name | Cell line | Activity type | Activity |
---|---|---|---|---|---|---|---|---|
WO2009037308 | 31 | MDM2 Q00987 |
|
Biochemical assay | ELISA | pIC50 (half maximal inhibitory concentration, -log10) | 6.00 | |
WO2009037308 | 31 | MDM2 Q00987 |
|
Cellular assay | Proliferation assay | A2780 cells | pIC50 (half maximal inhibitory concentration, -log10) | 5.59 |
Ta | Structure | Name | Drugbank ID |
---|---|---|---|
0.7091 | Serdemetan | DB12027 | |
0.6174 | 5-Methoxy-N,N-diisopropyltryptamine | DB01441 | |
0.6140 | 5-methoxy-N,N-dimethyltryptamine | DB14010 | |
0.6087 | Dipropyl-4-hydroxytryptamine | DB13990 | |
0.5985 | Oxypertine | DB13403 | |
0.5950 | Melatonin | DB01065 | |
0.5893 | Bufotenine | DB01445 | |
0.5714 | N-acetylserotonin | DB04275 | |
0.5446 | Serotonin | DB08839 | |
0.5405 | Diethyltryptamine | DB01460 | |
0.5273 | Dimethyltryptamine | DB01488 | |
0.5182 | Psilocybin | DB11664 | |
0.5180 | N-[2-(2-iodo-5-methoxy-1H-indol-3-yl)ethyl]acetamide | DB08190 | |
0.5062 | Bosutinib | DB06616 | |
0.5039 | Quinacrine | DB01103 |