Compound 536
Identifiers
- Canonical SMILES:
COc1c(Nc2ccnc3[C@@H](O)CCc23)ccc(NCCc2c[nH]c3c(cccc23)C(C)(C)O)c1F
- IUPAC name:
4-[3-fluoro-4-[2-[7-(2-hydroxypropan-2-yl)-1H-indol-3-yl]ethylamino]-2-methoxyanilino]-6,7-dihydro-5H-cyclopenta[b]pyridin-7-ol
- InChi:
InChI=1S/C28H31FN4O3/c1-28(2,35)19-6-4-5-17-16(15-32-25(17)19)11-13-30-21-8-9-22(27(36-3)24(21)29)33-20-12-14-31-26-18(20)7-10-23(26)34/h4-6,8-9,12,14-15,23,30,32,34-35H,7,10-11,13H2,1-3H3,(H,31,33)/t23-/m0/s1
- InChiKey:
IITQGAFQGWUZMO-QHCPKHFHSA-N
External links
![]() 168318178 |
External search
![]() |
![]() |
![]() |
![]() |
![]() |
Bibliography (1)
Publication | Name |
---|---|
Virginie Sophie Poncelet, Sophie Coupa, Pierre-Henri Storck, Bruno Schoentjes, Janssen Pharmaceutica Nv. . Inhibitors of the interaction between mdm2 and p53 None. | 63 |
Pharmacological data
Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
---|---|---|---|
1 | 1 | 0 | 0 |
Targets
PPI family | Best activity | Diseases | MMoA |
---|---|---|---|
MDM2-Like / P53 | 7.13 | cancer | Inhibition |
Physicochemical filters
Descriptor | Lipinski's RO5 | Veber | Pfizer's 3/75 | |
---|---|---|---|---|
Compliance | ||||
MW | 490.24 g/mol | |||
HBA | 7 | |||
HBD | 5 | |||
HBA + HBD | 12 | |||
AlogP | 3.71 | |||
TPSA | 102.43 | |||
RB | 8 |
Radar chart
PCA : iPPI-DB chemical space
PCA : Correlation circle
Efficiencies: iPPI-DB biplot LE versus LLE
Summary
Bibliographic ressources | Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
---|---|---|---|---|
1 | 1 | 1 | 0 | 0 |
Pharmacological data
Bibliography | Name | Target | Competition | Assay type | Assay name | Cell line | Activity type | Activity |
---|---|---|---|---|---|---|---|---|
WO2009037308 | 63 | MDM2 Q00987 |
|
Biochemical assay | ELISA | pIC50 (half maximal inhibitory concentration, -log10) | 6.00 | |
WO2009037308 | 63 | MDM2 Q00987 |
|
Cellular assay | Proliferation assay | A2780 cells | pIC50 (half maximal inhibitory concentration, -log10) | 7.13 |
Ta | Structure | Name | Drugbank ID |
---|---|---|---|
0.4919 | TACRINE(8)-4-AMINOQUINOLINE | DB04616 | |
0.4919 | (9S)-9-[(8-AMMONIOOCTYL)AMINO]-1,2,3,4,9,10-HEXAHYDROACRIDINIUM | DB04617 | |
0.4817 | 9-(3-IODOBENZYLAMINO)-1,2,3,4-TETRAHYDROACRIDINE | DB07940 | |
0.4817 | Frovatriptan | DB00998 | |
0.4783 | 9-N-Phenylmethylamino-Tacrine | DB03672 | |
0.4643 | Serdemetan | DB12027 | |
0.4562 | Nadifloxacin | DB12447 | |
0.4494 | Ipidacrine | DB13668 | |
0.4450 | Etrasimod | DB14766 | |
0.4434 | 9-benzyl-2,3,4,9-tetrahydro-1H-carbazole-8-carboxylic acid | DB07283 | |
0.4330 | LTX-109 | DB12711 | |
0.4317 | Cebranopadol | DB12830 | |
0.4312 | 5-(3-carbamoylbenzyl)-5,6,7,8,9,10-hexahydrocyclohepta[b]indole-4-carboxylic acid | DB07945 | |
0.4310 | Tacrine | DB00382 | |
0.4278 | Oxypertine | DB13403 |