Compound 431
Identifiers
- Canonical SMILES:
Cc1cc(Nc2ccnc3[C@H](O)CCc23)c(Cl)cc1NCCc1c[nH]c2c(C)cccc12
- IUPAC name:
4-[2-chloro-5-methyl-4-[2-(7-methyl-1H-indol-3-yl)ethylamino]anilino]-6,7-dihydro-5H-cyclopenta[b]pyridin-7-ol
- InChi:
InChI=1S/C26H27ClN4O/c1-15-4-3-5-18-17(14-30-25(15)18)8-10-28-22-13-20(27)23(12-16(22)2)31-21-9-11-29-26-19(21)6-7-24(26)32/h3-5,9,11-14,24,28,30,32H,6-8,10H2,1-2H3,(H,29,31)/t24-/m1/s1
- InChiKey:
VWZIEKKIVSAMHN-XMMPIXPASA-N
External links
168318214 |
External search
Bibliography (1)
Publication | Name |
---|---|
Virginie Sophie Poncelet, Sophie Coupa, Pierre-Henri Storck, Bruno Schoentjes, Janssen Pharmaceutica Nv. . Inhibitors of the interaction between mdm2 and p53 None. | 10 |
Pharmacological data
Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
---|---|---|---|
1 | 1 | 0 | 0 |
Targets
PPI family | Best activity | Diseases | MMoA |
---|---|---|---|
MDM2-Like / P53 | 5.45 | cancer | Inhibition |
Physicochemical filters
Descriptor | Lipinski's RO5 | Veber | Pfizer's 3/75 | |
---|---|---|---|---|
Compliance | ||||
MW | 446.19 g/mol | |||
HBA | 5 | |||
HBD | 4 | |||
HBA + HBD | 9 | |||
AlogP | 5.42 | |||
TPSA | 72.97 | |||
RB | 6 |
Radar chart
PCA : iPPI-DB chemical space
PCA : Correlation circle
Efficiencies: iPPI-DB biplot LE versus LLE
Summary
Bibliographic ressources | Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
---|---|---|---|---|
1 | 1 | 1 | 0 | 0 |
Pharmacological data
Bibliography | Name | Target | Competition | Assay type | Assay name | Cell line | Activity type | Activity |
---|---|---|---|---|---|---|---|---|
WO2009037308 | 10 | MDM2 Q00987 |
|
Biochemical assay | ELISA | pIC50 (half maximal inhibitory concentration, -log10) | 5.00 | |
WO2009037308 | 10 | MDM2 Q00987 |
|
Cellular assay | Proliferation assay | A2780 cells | pIC50 (half maximal inhibitory concentration, -log10) | 5.45 |
Ta | Structure | Name | Drugbank ID |
---|---|---|---|
0.5706 | TACRINE(8)-4-AMINOQUINOLINE | DB04616 | |
0.5706 | (9S)-9-[(8-AMMONIOOCTYL)AMINO]-1,2,3,4,9,10-HEXAHYDROACRIDINIUM | DB04617 | |
0.5460 | 9-N-Phenylmethylamino-Tacrine | DB03672 | |
0.5270 | Serdemetan | DB12027 | |
0.5202 | 9-(3-IODOBENZYLAMINO)-1,2,3,4-TETRAHYDROACRIDINE | DB07940 | |
0.5202 | Frovatriptan | DB00998 | |
0.5063 | Ipidacrine | DB13668 | |
0.4870 | Tacrine | DB00382 | |
0.4683 | LTX-109 | DB12711 | |
0.4667 | 9-benzyl-2,3,4,9-tetrahydro-1H-carbazole-8-carboxylic acid | DB07283 | |
0.4641 | Selisistat | DB13978 | |
0.4627 | (R)-tacrine(10)-hupyridone | DB04614 | |
0.4627 | (S)-tacrine(10)-hupyridone | DB04615 | |
0.4590 | Mdl-29951 | DB04175 | |
0.4527 | 5-(3-carbamoylbenzyl)-5,6,7,8,9,10-hexahydrocyclohepta[b]indole-4-carboxylic acid | DB07945 |