Compound 426
Identifiers
- Canonical SMILES:
Cc1c(NCCc2c[nH]c3ccccc23)ccc(Nc2ccnc(CO)c2)c1C
- IUPAC name:
[4-[4-[2-(1H-indol-3-yl)ethylamino]-2,3-dimethylanilino]pyridin-2-yl]methanol
- InChi:
InChI=1S/C24H26N4O/c1-16-17(2)23(28-19-10-12-25-20(13-19)15-29)8-7-22(16)26-11-9-18-14-27-24-6-4-3-5-21(18)24/h3-8,10,12-14,26-27,29H,9,11,15H2,1-2H3,(H,25,28)
- InChiKey:
DAOSFFINBCOBEQ-UHFFFAOYSA-N
External links
![]() 59493252 |
External search
|
|
|
|
|
Bibliography (1)
| Publication | Name |
|---|---|
| Virginie Sophie Poncelet, Sophie Coupa, Pierre-Henri Storck, Bruno Schoentjes, Janssen Pharmaceutica Nv. . Inhibitors of the interaction between mdm2 and p53 None. | 2 |
Pharmacological data
| Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|
| 1 | 0 | 0 | 0 |
Targets
| PPI family | Best activity | Diseases | MMoA |
|---|---|---|---|
| MDM2-Like / P53 | 5.52 | cancer | Inhibition |
Physicochemical filters
| Descriptor | Lipinski's RO5 | Veber | Pfizer's 3/75 | |
|---|---|---|---|---|
| Compliance | ||||
| MW | 386.21 g/mol | |||
| HBA | 5 | |||
| HBD | 4 | |||
| HBA + HBD | 9 | |||
| AlogP | 4.12 | |||
| TPSA | 72.97 | |||
| RB | 7 |
Radar chart
PCA : iPPI-DB chemical space
PCA : Correlation circle
Efficiencies: iPPI-DB biplot LE versus LLE
Summary
| Bibliographic ressources | Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|---|
| 1 | 1 | 0 | 0 | 0 |
Pharmacological data
| Bibliography | Name | Target | Competition | Assay type | Assay name | Cell line | Activity type | Activity |
|---|---|---|---|---|---|---|---|---|
| WO2009037308 | 2 | MDM2 Q00987 |
|
Biochemical assay | ELISA | pIC50 (half maximal inhibitory concentration, -log10) | 5.52 |
| Ta | Structure | Name | Drugbank ID |
|---|---|---|---|
| 0.7358 | Serdemetan | DB12027 | |
| 0.5472 | Dimethyltryptamine | DB01488 | |
| 0.5321 | Diethyltryptamine | DB01460 | |
| 0.5286 | TACRINE(8)-4-AMINOQUINOLINE | DB04616 | |
| 0.5286 | (9S)-9-[(8-AMMONIOOCTYL)AMINO]-1,2,3,4,9,10-HEXAHYDROACRIDINIUM | DB04617 | |
| 0.5234 | Rizatriptan | DB00953 | |
| 0.5130 | Bufotenine | DB01445 | |
| 0.5000 | 9-N-Phenylmethylamino-Tacrine | DB03672 | |
| 0.5000 | Tryptamine | DB08653 | |
| 0.4931 | Oxypertine | DB13403 | |
| 0.4878 | N-acetylserotonin | DB04275 | |
| 0.4876 | 5-methoxy-N,N-dimethyltryptamine | DB14010 | |
| 0.4836 | Dipropyl-4-hydroxytryptamine | DB13990 | |
| 0.4825 | (1S)-1-AMINO-2-(1H-INDOL-3-YL)ETHANOL | DB08649 | |
| 0.4821 | Indopan | DB01446 |




