Compound 392
Identifiers
- Canonical SMILES:
CN1CCN(CC1)C(=O)[C@@H]1N[C@H](CC(C)(C)C)[C@@]2([C@H]1c1ccc(F)c(Cl)c1)C(=O)Nc1cc(Cl)c(F)cc21
- IUPAC name:
(2'R,3S,4'R,5'R)-6-chloro-4'-(3-chloro-4-fluorophenyl)-2'-(2,2-dimethylpropyl)-5-fluoro-5'-(4-methylpiperazine-1-carbonyl)spiro[1H-indole-3,3'-pyrrolidine]-2-one
- InChi:
InChI=1S/C28H32Cl2F2N4O2/c1-27(2,3)14-22-28(16-12-20(32)18(30)13-21(16)33-26(28)38)23(15-5-6-19(31)17(29)11-15)24(34-22)25(37)36-9-7-35(4)8-10-36/h5-6,11-13,22-24,34H,7-10,14H2,1-4H3,(H,33,38)/t22-,23+,24-,28+/m1/s1
- InChiKey:
WLXCXBFCRBMECV-PVIBPIFHSA-N
External links
25000812 |
External search
Bibliography (1)
Publication | Name |
---|---|
Shaomeng Wang, Dongguang Qin, Jianyong Chen, Shanghai Yu, The Regents Of The University Of Michigan. . New small molecule inhibitors of mdm2 and the uses thereof None. | 319-9 |
Pharmacological data
Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
---|---|---|---|
1 | 3 | 0 | 0 |
Targets
PPI family | Best activity | Diseases | MMoA |
---|---|---|---|
MDM2-Like / P53 | 5.54 | cancer | Inhibition |
Physicochemical filters
Descriptor | Lipinski's RO5 | Veber | Pfizer's 3/75 | |
---|---|---|---|---|
Compliance | ||||
MW | 564.19 g/mol | |||
HBA | 6 | |||
HBD | 2 | |||
HBA + HBD | 8 | |||
AlogP | 4.88 | |||
TPSA | 64.68 | |||
RB | 4 |
Radar chart
PCA : iPPI-DB chemical space
PCA : Correlation circle
Efficiencies: iPPI-DB biplot LE versus LLE
Summary
Bibliographic ressources | Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
---|---|---|---|---|
1 | 1 | 3 | 0 | 0 |
Pharmacological data
Bibliography | Name | Target | Competition | Assay type | Assay name | Cell line | Activity type | Activity |
---|---|---|---|---|---|---|---|---|
WO2008036168 | 319-9 | MDM2 Q00987 |
|
Biochemical assay | Fluorescence Polarization | pIC50 (half maximal inhibitory concentration, -log10) | 5.45 | |
WO2008036168 | 319-9 | MDM2 Q00987 |
|
Cellular assay | Proliferation assay | LNCaP cells | pIC50 (half maximal inhibitory concentration, -log10) | 5.54 |
WO2008036168 | 319-9 | MDM2 Q00987 |
|
Cellular assay | Proliferation assay | HCT-116 cells p53WT | pIC50 (half maximal inhibitory concentration, -log10) | 5.13 |
WO2008036168 | 319-9 | MDM2 Q00987 |
|
Cellular assay | Proliferation assay | PC-3 cells | pIC50 (half maximal inhibitory concentration, -log10) | 4.51 |
Ta | Structure | Name | Drugbank ID |
---|---|---|---|
0.8090 | SAR-405838 | DB12541 | |
0.6396 | Milademetan | DB15257 | |
0.5388 | MK-3207 | DB12424 | |
0.5300 | Mosapramine | DB13676 | |
0.5183 | 3-[4-(1-formylpiperazin-4-yl)-benzylidenyl]-2-indolinone | DB02058 | |
0.5138 | Degarelix | DB06699 | |
0.5131 | SLV-334 | DB15356 | |
0.5091 | Idasanutlin | DB12325 | |
0.5054 | Lumateperone | DB06077 | |
0.5030 | (3S)-N-(3-CHLORO-2-METHYLPHENYL)-1-CYCLOHEXYL-5-OXOPYRROLIDINE-3-CARBOXAMIDE | DB07090 | |
0.5030 | (3S)-N-(5-CHLORO-2-METHYLPHENYL)-1-CYCLOHEXYL-5-OXOPYRROLIDINE-3-CARBOXAMIDE | DB07222 | |
0.5000 | OPC-14523 | DB05422 | |
0.4975 | Daglutril | DB05796 | |
0.4973 | OPC-51803 | DB05838 | |
0.4900 | Acyline | DB11906 |