Compound 308
Identifiers
- Canonical SMILES:
O[C@H]1CCc2c1nccc2Nc1cc(c(NCCc2c[nH]c3ccccc23)c(c1)C(F)(F)F)C(F)(F)F
- IUPAC name:
4-[4-[2-(1H-indol-3-yl)ethylamino]-3,5-bis(trifluoromethyl)anilino]-6,7-dihydro-5H-cyclopenta[b]pyridin-7-ol
- InChi:
InChI=1S/C26H22F6N4O/c27-25(28,29)18-11-15(36-21-8-10-33-23-17(21)5-6-22(23)37)12-19(26(30,31)32)24(18)34-9-7-14-13-35-20-4-2-1-3-16(14)20/h1-4,8,10-13,22,34-35,37H,5-7,9H2,(H,33,36)/t22-/m0/s1
- InChiKey:
LSPZUTKLZSBKIG-QFIPXVFZSA-N
External links
![]() 168318245 |
External search
|
|
|
|
|
Bibliography (1)
| Publication | Name |
|---|---|
| Virginie Sophie Poncelet, Sophie Coupa, Pierre-Henri Storck, Bruno Schoentjes, Janssen Pharmaceutica Nv. . Inhibitors of the interaction between mdm2 and p53 None. | 5 |
Pharmacological data
| Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|
| 1 | 0 | 0 | 0 |
Targets
| PPI family | Best activity | Diseases | MMoA |
|---|---|---|---|
| MDM2-Like / P53 | 6.52 | cancer | Inhibition |
Physicochemical filters
| Descriptor | Lipinski's RO5 | Veber | Pfizer's 3/75 | |
|---|---|---|---|---|
| Compliance | ||||
| MW | 520.17 g/mol | |||
| HBA | 5 | |||
| HBD | 4 | |||
| HBA + HBD | 9 | |||
| AlogP | 5.55 | |||
| TPSA | 72.97 | |||
| RB | 8 |
Radar chart
PCA : iPPI-DB chemical space
PCA : Correlation circle
Efficiencies: iPPI-DB biplot LE versus LLE
Summary
| Bibliographic ressources | Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|---|
| 1 | 1 | 0 | 0 | 0 |
Pharmacological data
| Bibliography | Name | Target | Competition | Assay type | Assay name | Cell line | Activity type | Activity |
|---|---|---|---|---|---|---|---|---|
| WO2009037308 | 5 | MDM2 Q00987 |
|
Biochemical assay | ELISA | pIC50 (half maximal inhibitory concentration, -log10) | 6.52 |
| Ta | Structure | Name | Drugbank ID |
|---|---|---|---|
| 0.5875 | TACRINE(8)-4-AMINOQUINOLINE | DB04616 | |
| 0.5875 | (9S)-9-[(8-AMMONIOOCTYL)AMINO]-1,2,3,4,9,10-HEXAHYDROACRIDINIUM | DB04617 | |
| 0.5625 | 9-N-Phenylmethylamino-Tacrine | DB03672 | |
| 0.5444 | Frovatriptan | DB00998 | |
| 0.5353 | 9-(3-IODOBENZYLAMINO)-1,2,3,4-TETRAHYDROACRIDINE | DB07940 | |
| 0.5342 | Serdemetan | DB12027 | |
| 0.5128 | Ipidacrine | DB13668 | |
| 0.4934 | Tacrine | DB00382 | |
| 0.4822 | (R)-tacrine(10)-hupyridone | DB04614 | |
| 0.4822 | (S)-tacrine(10)-hupyridone | DB04615 | |
| 0.4792 | 9-benzyl-2,3,4,9-tetrahydro-1H-carbazole-8-carboxylic acid | DB07283 | |
| 0.4724 | Etrasimod | DB14766 | |
| 0.4657 | LTX-109 | DB12711 | |
| 0.4646 | 5-(3-carbamoylbenzyl)-5,6,7,8,9,10-hexahydrocyclohepta[b]indole-4-carboxylic acid | DB07945 | |
| 0.4567 | Cebranopadol | DB12830 |




