Compound 25
Identifiers
- Canonical SMILES:
COc1c(Nc2ccnc3[C@@H](O)CCc23)ccc(NCCc2c[nH]c3c(cccc23)C(C)=C)c1F
- IUPAC name:
4-[3-fluoro-2-methoxy-4-[2-(7-prop-1-en-2-yl-1H-indol-3-yl)ethylamino]anilino]-6,7-dihydro-5H-cyclopenta[b]pyridin-7-ol
- InChi:
InChI=1S/C28H29FN4O2/c1-16(2)18-5-4-6-19-17(15-32-26(18)19)11-13-30-22-8-9-23(28(35-3)25(22)29)33-21-12-14-31-27-20(21)7-10-24(27)34/h4-6,8-9,12,14-15,24,30,32,34H,1,7,10-11,13H2,2-3H3,(H,31,33)/t24-/m0/s1
- InChiKey:
SDGNLJQANKDFMF-DEOSSOPVSA-N
External links
59493273 |
External search
Bibliography (1)
Publication | Name |
---|---|
Virginie Sophie Poncelet, Sophie Coupa, Pierre-Henri Storck, Bruno Schoentjes, Janssen Pharmaceutica Nv. . Inhibitors of the interaction between mdm2 and p53 None. | 64 |
Pharmacological data
Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
---|---|---|---|
1 | 1 | 0 | 0 |
Targets
PPI family | Best activity | Diseases | MMoA |
---|---|---|---|
MDM2-Like / P53 | 7.07 | cancer | Inhibition |
Physicochemical filters
Descriptor | Lipinski's RO5 | Veber | Pfizer's 3/75 | |
---|---|---|---|---|
Compliance | ||||
MW | 472.23 g/mol | |||
HBA | 6 | |||
HBD | 4 | |||
HBA + HBD | 10 | |||
AlogP | 4.81 | |||
TPSA | 82.20 | |||
RB | 8 |
Radar chart
PCA : iPPI-DB chemical space
PCA : Correlation circle
Efficiencies: iPPI-DB biplot LE versus LLE
Summary
Bibliographic ressources | Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
---|---|---|---|---|
1 | 1 | 1 | 0 | 0 |
Pharmacological data
Bibliography | Name | Target | Competition | Assay type | Assay name | Cell line | Activity type | Activity |
---|---|---|---|---|---|---|---|---|
WO2009037308 | 64 | MDM2 Q00987 |
|
Biochemical assay | ELISA | pIC50 (half maximal inhibitory concentration, -log10) | 6.52 | |
WO2009037308 | 64 | MDM2 Q00987 |
|
Cellular assay | Proliferation assay | A2780 cells | pIC50 (half maximal inhibitory concentration, -log10) | 7.07 |
Ta | Structure | Name | Drugbank ID |
---|---|---|---|
0.4840 | TACRINE(8)-4-AMINOQUINOLINE | DB04616 | |
0.4840 | (9S)-9-[(8-AMMONIOOCTYL)AMINO]-1,2,3,4,9,10-HEXAHYDROACRIDINIUM | DB04617 | |
0.4742 | 9-(3-IODOBENZYLAMINO)-1,2,3,4-TETRAHYDROACRIDINE | DB07940 | |
0.4706 | 9-N-Phenylmethylamino-Tacrine | DB03672 | |
0.4592 | Frovatriptan | DB00998 | |
0.4561 | Serdemetan | DB12027 | |
0.4420 | Ipidacrine | DB13668 | |
0.4369 | Nadifloxacin | DB12447 | |
0.4324 | Etrasimod | DB14766 | |
0.4261 | Cebranopadol | DB12830 | |
0.4237 | Tacrine | DB00382 | |
0.4213 | Oxypertine | DB13403 | |
0.4210 | LTX-109 | DB12711 | |
0.4174 | 9-benzyl-2,3,4,9-tetrahydro-1H-carbazole-8-carboxylic acid | DB07283 | |
0.4154 | Emicerfont | DB12910 |