Compound 2411
Identifiers
- Canonical SMILES:
CC(C)(C)CC[C@H](NC(=O)c1ccc(Oc2ccccc2)nc1)C(O)=O
- IUPAC name:
(2S)-5,5-dimethyl-2-[(6-phenoxypyridin-3-yl)formamido]hexanoic acid
- InChi:
InChI=1S/C20H24N2O4/c1-20(2,3)12-11-16(19(24)25)22-18(23)14-9-10-17(21-13-14)26-15-7-5-4-6-8-15/h4-10,13,16H,11-12H2,1-3H3,(H,22,23)(H,24,25)/t16-/m0/s1
- InChiKey:
OWESOSHRVQOBOS-INIZCTEOSA-N
External links
![]() 162653277 |
![]() CHEMBL4752312 |
External search
![]() |
![]() |
![]() |
![]() |
![]() |
Bibliography (1)
Pharmacological data
Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
---|---|---|---|
1 | 1 | 0 | 0 |
Targets
PPI family | Best activity | Diseases | MMoA |
---|---|---|---|
Sortilin / Progranulin | 7.70 | Huntington disease , Alzheimer disease, familial early-onset, with coexisting amyloid and prion pathology , parkinson disease 3, autosomal dominant , parkinson disease 12 | Inhibition |
Physicochemical filters
Descriptor | Lipinski's RO5 | Veber | Pfizer's 3/75 | |
---|---|---|---|---|
Compliance | ||||
MW | 356.17 g/mol | |||
HBA | 6 | |||
HBD | 2 | |||
HBA + HBD | 8 | |||
AlogP | 3.97 | |||
TPSA | 91.35 | |||
RB | 8 |
Radar chart
PCA : iPPI-DB chemical space
PCA : Correlation circle
Efficiencies: iPPI-DB biplot LE versus LLE
Summary
Bibliographic ressources | Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
---|---|---|---|---|
1 | 1 | 1 | 0 | 0 |
Pharmacological data
Bibliography | Name | Target | Competition | Assay type | Assay name | Cell line | Activity type | Activity |
---|---|---|---|---|---|---|---|---|
10.1016/j.bmcl.2020.127403 | 23 | SORT Q99523 |
NEUT P30990 |
Biochemical assay | HTRF | pIC50 (half maximal inhibitory concentration, -log10) | 7.70 | |
10.1016/j.bmcl.2020.127403 | 23 | SORT Q99523 |
NEUT P30990 |
Cellular assay | Progranulin uptake | HEK293 | pIC50 (half maximal inhibitory concentration, -log10) | 6.92 |
Ta | Structure | Name | Drugbank ID |
---|---|---|---|
0.7192 | Ondelopran | DB12585 | |
0.7007 | JNJ-39220675 | DB12929 | |
0.5893 | UK-500001 | DB12837 | |
0.5732 | LY-377604 | DB12858 | |
0.5658 | 4-(3-{[5-(trifluoromethyl)pyridin-2-yl]oxy}benzyl)piperidine-1-carboxylic acid | DB08400 | |
0.5283 | DCFPyL F-18 | DB14805 | |
0.5115 | Bevenopran | DB12464 | |
0.5066 | Haloxyfop-P | DB07870 | |
0.5036 | Picotamide | DB13327 | |
0.5000 | [4-(3-AMINOMETHYL-PHENYL)-PIPERIDIN-1-YL]-(5-PHENETHYL- PYRIDIN-3-YL)-METHANONE | DB04764 | |
0.4908 | Aplaviroc | DB06497 | |
0.4888 | Piboserod | DB04873 | |
0.4804 | Indinavir | DB00224 | |
0.4692 | Aniracetam | DB04599 | |
0.4677 | Biricodar | DB04851 |