Compound 2409
Identifiers
- Canonical SMILES:
CC(C)(C)CC[C@H](NC(=O)c1cc(Cl)cc(Cl)c1)C(O)=O
- IUPAC name:
(2S)-2-[(3,5-dichlorophenyl)formamido]-5,5-dimethylhexanoic acid
- InChi:
InChI=1S/C15H19Cl2NO3/c1-15(2,3)5-4-12(14(20)21)18-13(19)9-6-10(16)8-11(17)7-9/h6-8,12H,4-5H2,1-3H3,(H,18,19)(H,20,21)/t12-/m0/s1
- InChiKey:
GTMNLKRWZVHZAV-LBPRGKRZSA-N
External links
![]() 153835400 |
![]() CHEMBL4741088 |
UP4 |
External search
|
|
|
|
|
Bibliography (1)
Pharmacological data
| Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|
| 1 | 1 | 0 | 0 |
Targets
| PPI family | Best activity | Diseases | MMoA |
|---|---|---|---|
| Sortilin / Progranulin | 6.77 | Huntington disease , Alzheimer disease, familial early-onset, with coexisting amyloid and prion pathology , parkinson disease 3, autosomal dominant , parkinson disease 12 | Inhibition |
Physicochemical filters
| Descriptor | Lipinski's RO5 | Veber | Pfizer's 3/75 | |
|---|---|---|---|---|
| Compliance | ||||
| MW | 331.07 g/mol | |||
| HBA | 4 | |||
| HBD | 2 | |||
| HBA + HBD | 6 | |||
| AlogP | 4.30 | |||
| TPSA | 69.23 | |||
| RB | 6 |
Radar chart
PCA : iPPI-DB chemical space
PCA : Correlation circle
Efficiencies: iPPI-DB biplot LE versus LLE
Summary
| Bibliographic ressources | Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|---|
| 1 | 1 | 1 | 0 | 0 |
Pharmacological data
| Bibliography | Name | Target | Competition | Assay type | Assay name | Cell line | Activity type | Activity |
|---|---|---|---|---|---|---|---|---|
| 10.1016/j.bmcl.2020.127403 | 17 | SORT Q99523 |
NEUT P30990 |
Biochemical assay | HTRF | pIC50 (half maximal inhibitory concentration, -log10) | 6.77 | |
| 10.1016/j.bmcl.2020.127403 | 17 | SORT Q99523 |
NEUT P30990 |
Cellular assay | Progranulin uptake | HEK293 | pIC50 (half maximal inhibitory concentration, -log10) | 6.19 |
| Ta | Structure | Name | Drugbank ID |
|---|---|---|---|
| 0.6546 | Dexloxiglumide | DB04856 | |
| 0.6289 | N-(3-chlorobenzyl)-1-(4-methylpentanoyl)-L-prolinamide | DB06868 | |
| 0.6220 | N-BENZOYL-D-ALANINE | DB08508 | |
| 0.6200 | Proglumide | DB13431 | |
| 0.6176 | 3-cyclohexyl-D-alanyl-N-(3-chlorobenzyl)-L-prolinamide | DB07190 | |
| 0.6168 | Danegaptide | DB11821 | |
| 0.6162 | 1-[(2R)-2-aminobutanoyl]-N-(3-chlorobenzyl)-L-prolinamide | DB06878 | |
| 0.6162 | D-leucyl-N-(3-chlorobenzyl)-L-prolinamide | DB06911 | |
| 0.6132 | N-{4-[(Carboxymethyl)carbamoyl]benzoyl}-L-valyl-N-[(3S)-1,1,1-trifluoro-4-methyl-2-oxo-3-pentanyl]-L-prolinamide | DB03702 | |
| 0.5765 | N-(2-AMINOETHYL)-P-CHLOROBENZAMIDE | DB08082 | |
| 0.5688 | Iofolastat I-123 | DB12514 | |
| 0.5641 | (2s)-2-[(2,4-Dichloro-Benzoyl)-(3-Trifluoromethyl-Benzyl)-Amino]-3-Phenyl-Propionic Acid | DB03605 | |
| 0.5600 | 4-(dimethylamino)-N-[7-(hydroxyamino)-7-oxoheptyl]benzamide | DB02565 | |
| 0.5581 | GLPG-0974 | DB15406 | |
| 0.5540 | Naronapride | DB05542 |




