Compound 2335
Identifiers
- Canonical SMILES:
COc1cc(ccc1NC(=O)[C@@H]1N[C@@H](CC(C)(C)C)[C@]2([C@H]1c1cccc(Cl)c1F)C(=O)Nc1cc(Cl)sc21)C(O)=O
- IUPAC name:
4-{[(2S,3R,4R,5R)-2'-chloro-4-(3-chloro-2-fluorophenyl)-2-(2,2-dimethylpropyl)-5'-oxo-4',5'-dihydrospiro[pyrrolidine-3,6'-thieno[3,2-b]pyrrol]-5-yl]amido}-3-methoxybenzoic acid - InChi:
InChI=1S/C29H28Cl2FN3O5S/c1-28(2,3)12-19-29(24-17(34-27(29)39)11-20(31)41-24)21(14-6-5-7-15(30)22(14)32)23(35-19)25(36)33-16-9-8-13(26(37)38)10-18(16)40-4/h5-11,19,21,23,35H,12H2,1-4H3,(H,33,36)(H,34,39)(H,37,38)/t19-,21-,23+,29+/m0/s1
- InChiKey:
YXQHJKFKRZDXHV-HNXAPSNLSA-N
External links
![]() 56941233 |
![]() CHEMBL3109041 |
External search
|
|
|
|
|
Bibliography (1)
| Publication | Name |
|---|---|
| Vassilev L. T.. . In Vivo Activation of the p53 Pathway by Small-Molecule Antagonists of MDM2 Science. | 15 |
Pharmacological data
| Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|
| 1 | 1 | 1 | 0 |
Targets
| PPI family | Best activity | Diseases | MMoA |
|---|---|---|---|
| MDM2-Like / P53 | 8.52 | cancer | Inhibition |
Physicochemical filters
| Descriptor | Lipinski's RO5 | Veber | Pfizer's 3/75 | |
|---|---|---|---|---|
| Compliance | ||||
| MW | 619.11 g/mol | |||
| HBA | 8 | |||
| HBD | 4 | |||
| HBA + HBD | 12 | |||
| AlogP | 3.79 | |||
| TPSA | 124.17 | |||
| RB | 7 |
Radar chart
PCA : iPPI-DB chemical space
PCA : Correlation circle
Efficiencies: iPPI-DB biplot LE versus LLE
Summary
| Bibliographic ressources | Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|---|
| 1 | 1 | 1 | 1 | 0 |
Pharmacological data
| Bibliography | Name | Target | Competition | Assay type | Assay name | Cell line | Activity type | Activity |
|---|---|---|---|---|---|---|---|---|
| 10.1126/science.1092472 | 15 | MDM2 Q00987 |
P53 P04637 |
Biochemical assay | HTRF | pIC50 (half maximal inhibitory concentration, -log10) | 8.15 | |
| 10.1126/science.1092472 | 15 | MDM2 Q00987 |
P53 P04637 |
Cellular assay | MTT-assay | SJSA-1 + HCT116 + RKO | pIC50 (half maximal inhibitory concentration, -log10) | 8.52 |
PK data
| Bibliography | Name | Assay name | Administration mode | Dose (mg/kg) | Dose interval (hours) | Tolerated | AUC | Clearance | Cmax | Oral bioavailability | T1/2 (min) | Tmax (min) | Volume distribution (Vd) |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| 10.1126/science.1092472 | 15 | Mouse PK PO | PO | 10.00 | None | yes | yes | yes | no | 32 | 101 | None | no |
| Ta | Structure | Name | Drugbank ID |
|---|---|---|---|
| 0.6115 | Idasanutlin | DB12325 | |
| 0.5914 | SAR-405838 | DB12541 | |
| 0.5392 | Milademetan | DB15257 | |
| 0.4040 | Degarelix | DB06699 | |
| 0.4027 | 3-{6-[(8-HYDROXY-QUINOLINE-2-CARBONYL)-AMINO]-2-THIOPHEN-2-YL-HEXANOYLAMINO}-4-OXO-BUTYRI ACID | DB07916 | |
| 0.3930 | Labradimil | DB06549 | |
| 0.3924 | OPC-14523 | DB05422 | |
| 0.3879 | Satavaptan | DB14923 | |
| 0.3858 | (S)-2-CHLORO-N-(1-(2-(2-HYDROXYETHYLAMINO)-2-OXOETHYL)-2-OXO-1,2,3,4-TETRAHYDROQUINOLIN-3-YL)-6H-THIENO[2,3-B]PYRROLE-5-CARBOXAMIDE | DB07792 | |
| 0.3811 | MK-3207 | DB12424 | |
| 0.3797 | OPC-51803 | DB05838 | |
| 0.3790 | 2-CHLORO-N-[(3R)-2-OXO-1,2,3,4-TETRAHYDROQUINOLIN-3-YL]-6H-THIENO[2,3-B]PYRROLE-5-CARBOXAMIDE | DB07066 | |
| 0.3786 | N-[3-[4-(3-aminopropyl)piperazin-1-yl]propyl]-3-[(2-thiophen-2-ylacetyl)amino]-5-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzamide | DB03524 | |
| 0.3750 | Relcovaptan | DB13929 | |
| 0.3739 | Ubrogepant | DB15328 |




