Compound 2334
Identifiers
- Common name: RO2468
- Canonical SMILES:
COc1cc(ccc1NC(=O)[C@H]1N[C@H](CC(C)(C)C)[C@@]2([C@@H]1c1cccc(Cl)c1F)C(=O)Nc1cc(Cl)ncc21)C(N)=O
- IUPAC name:
(2R,3S,4R,5S)-N-(4-carbamoyl-2-methoxyphenyl)-6'-chloro-4-(3-chloro-2-fluorophenyl)-2-(2,2-dimethylpropyl)-2'-oxo-1',2'-dihydrospiro[pyrrolidine-3,3'-pyrrolo[3,2-c]pyridine]-5-carboxamide
- InChi:
InChI=1S/C30H30Cl2FN5O4/c1-29(2,3)12-21-30(16-13-35-22(32)11-19(16)37-28(30)41)23(15-6-5-7-17(31)24(15)33)25(38-21)27(40)36-18-9-8-14(26(34)39)10-20(18)42-4/h5-11,13,21,23,25,38H,12H2,1-4H3,(H2,34,39)(H,36,40)(H,37,41)/t21-,23-,25+,30+/m1/s1
- InChiKey:
CGCOPBXAGSCZNX-JLEYQQFFSA-N
External links
![]() 56942527 |
![]() CHEMBL3109039 |
External search
|
|
|
|
|
Bibliography (1)
| Publication | Name |
|---|---|
| Vassilev L. T.. . In Vivo Activation of the p53 Pathway by Small-Molecule Antagonists of MDM2 Science. | 14 |
Pharmacological data
| Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|
| 1 | 1 | 1 | 0 |
Targets
| PPI family | Best activity | Diseases | MMoA |
|---|---|---|---|
| MDM2-Like / P53 | 8.22 | cancer | Inhibition |
Physicochemical filters
| Descriptor | Lipinski's RO5 | Veber | Pfizer's 3/75 | |
|---|---|---|---|---|
| Compliance | ||||
| MW | 613.17 g/mol | |||
| HBA | 9 | |||
| HBD | 5 | |||
| HBA + HBD | 14 | |||
| AlogP | 4.38 | |||
| TPSA | 140.02 | |||
| RB | 7 |
Radar chart
PCA : iPPI-DB chemical space
PCA : Correlation circle
Efficiencies: iPPI-DB biplot LE versus LLE
Summary
| Bibliographic ressources | Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|---|
| 1 | 1 | 1 | 1 | 0 |
Pharmacological data
| Bibliography | Name | Target | Competition | Assay type | Assay name | Cell line | Activity type | Activity |
|---|---|---|---|---|---|---|---|---|
| 10.1126/science.1092472 | 14 | MDM2 Q00987 |
P53 P04637 |
Biochemical assay | HTRF | pIC50 (half maximal inhibitory concentration, -log10) | 8.22 | |
| 10.1126/science.1092472 | 14 | MDM2 Q00987 |
P53 P04637 |
Cellular assay | MTT-assay | SJSA-1 + HCT116 + RKO | pIC50 (half maximal inhibitory concentration, -log10) | 7.82 |
PK data
| Bibliography | Name | Assay name | Administration mode | Dose (mg/kg) | Dose interval (hours) | Tolerated | AUC | Clearance | Cmax | Oral bioavailability | T1/2 (min) | Tmax (min) | Volume distribution (Vd) |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| 10.1126/science.1092472 | 14 | Mouse PK PO | PO | 5.00 | None | yes | yes | yes | no | 46 | 180 | None | no |
| Ta | Structure | Name | Drugbank ID |
|---|---|---|---|
| 0.6800 | SAR-405838 | DB12541 | |
| 0.6601 | Milademetan | DB15257 | |
| 0.6511 | Idasanutlin | DB12325 | |
| 0.5502 | Degarelix | DB06699 | |
| 0.5412 | MK-3207 | DB12424 | |
| 0.5148 | Abarelix | DB00106 | |
| 0.5144 | Ubrogepant | DB15328 | |
| 0.5128 | Acyline | DB11906 | |
| 0.4850 | Daptomycin | DB00080 | |
| 0.4718 | Tifuvirtide | DB05413 | |
| 0.4694 | Ozarelix | DB12581 | |
| 0.4691 | Timcodar | DB12761 | |
| 0.4667 | Teverelix | DB05624 | |
| 0.4594 | Cipargamin | DB12306 | |
| 0.4571 | Cetrorelix | DB00050 |




