Compound 2331
Identifiers
- Canonical SMILES:
COc1cc(ccc1NC(=O)C1NC(CC(C)(C)C)C2(C1c1cccc(Cl)c1F)C(=O)Nc1nc(Cl)ncc21)C(N)=O
- IUPAC name:
N-(4-carbamoyl-2-methoxyphenyl)-2'-chloro-4-(3-chloro-2-fluorophenyl)-2-(2,2-dimethylpropyl)-6'-oxo-6',7'-dihydrospiro[pyrrolidine-3,5'-pyrrolo[2,3-d]pyrimidine]-5-carboxamide
- InChi:
InChI=1S/C29H29Cl2FN6O4/c1-28(2,3)11-19-29(15-12-34-27(31)38-24(15)37-26(29)41)20(14-6-5-7-16(30)21(14)32)22(36-19)25(40)35-17-9-8-13(23(33)39)10-18(17)42-4/h5-10,12,19-20,22,36H,11H2,1-4H3,(H2,33,39)(H,35,40)(H,34,37,38,41)
- InChiKey:
ORCGOHBRBKYLAQ-UHFFFAOYSA-N
External links
![]() 76468288 |
External search
|
|
|
|
|
Bibliography (1)
| Publication | Name |
|---|---|
| Vassilev L. T.. . In Vivo Activation of the p53 Pathway by Small-Molecule Antagonists of MDM2 Science. | 11 |
Pharmacological data
| Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|
| 1 | 1 | 0 | 0 |
Targets
| PPI family | Best activity | Diseases | MMoA |
|---|---|---|---|
| MDM2-Like / P53 | 7.35 | cancer | Inhibition |
Physicochemical filters
| Descriptor | Lipinski's RO5 | Veber | Pfizer's 3/75 | |
|---|---|---|---|---|
| Compliance | ||||
| MW | 614.16 g/mol | |||
| HBA | 10 | |||
| HBD | 5 | |||
| HBA + HBD | 15 | |||
| AlogP | 4.21 | |||
| TPSA | 152.91 | |||
| RB | 7 |
Radar chart
PCA : iPPI-DB chemical space
PCA : Correlation circle
Efficiencies: iPPI-DB biplot LE versus LLE
Summary
| Bibliographic ressources | Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|---|
| 1 | 1 | 1 | 0 | 0 |
Pharmacological data
| Bibliography | Name | Target | Competition | Assay type | Assay name | Cell line | Activity type | Activity |
|---|---|---|---|---|---|---|---|---|
| 10.1126/science.1092472 | 11 | MDM2 Q00987 |
P53 P04637 |
Biochemical assay | HTRF | pIC50 (half maximal inhibitory concentration, -log10) | 7.35 | |
| 10.1126/science.1092472 | 11 | MDM2 Q00987 |
P53 P04637 |
Cellular assay | MTT-assay | SJSA-1 cells | pIC50 (half maximal inhibitory concentration, -log10) | 7.05 |
| Ta | Structure | Name | Drugbank ID |
|---|---|---|---|
| 0.6652 | Idasanutlin | DB12325 | |
| 0.6438 | SAR-405838 | DB12541 | |
| 0.5918 | Milademetan | DB15257 | |
| 0.5133 | MK-3207 | DB12424 | |
| 0.5000 | Ubrogepant | DB15328 | |
| 0.4904 | Volasertib | DB12062 | |
| 0.4811 | Degarelix | DB06699 | |
| 0.4762 | Ipatasertib | DB11743 | |
| 0.4572 | Bremelanotide | DB11653 | |
| 0.4552 | CEP-37440 | DB13060 | |
| 0.4531 | Capivasertib | DB12218 | |
| 0.4529 | Cotadutide | DB15194 | |
| 0.4525 | LY249543 | DB04322 | |
| 0.4525 | Lometrexol | DB12769 | |
| 0.4517 | Semaglutide | DB13928 |




