Compound 2330
Identifiers
- Canonical SMILES:
COc1cc(ccc1NC(=O)C1NC(CC(C)(C)C)C2(C1c1cccc(Cl)c1F)C(=O)Nc1nc(Cl)ncc21)C(O)=O
- IUPAC name:
4-{[2'-chloro-4-(3-chloro-2-fluorophenyl)-2-(2,2-dimethylpropyl)-6'-oxo-6',7'-dihydrospiro[pyrrolidine-3,5'-pyrrolo[2,3-d]pyrimidin]-5-yl]amido}-3-methoxybenzoic acid - InChi:
InChI=1S/C29H28Cl2FN5O5/c1-28(2,3)11-19-29(15-12-33-27(31)37-23(15)36-26(29)41)20(14-6-5-7-16(30)21(14)32)22(35-19)24(38)34-17-9-8-13(25(39)40)10-18(17)42-4/h5-10,12,19-20,22,35H,11H2,1-4H3,(H,34,38)(H,39,40)(H,33,36,37,41)
- InChiKey:
JMUOXYBXFJQWPT-UHFFFAOYSA-N
External links
![]() 76468239 |
External search
|
|
|
|
|
Bibliography (1)
| Publication | Name |
|---|---|
| Vassilev L. T.. . In Vivo Activation of the p53 Pathway by Small-Molecule Antagonists of MDM2 Science. | 10 |
Pharmacological data
| Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|
| 1 | 1 | 0 | 0 |
Targets
| PPI family | Best activity | Diseases | MMoA |
|---|---|---|---|
| MDM2-Like / P53 | 7.60 | cancer | Inhibition |
Physicochemical filters
| Descriptor | Lipinski's RO5 | Veber | Pfizer's 3/75 | |
|---|---|---|---|---|
| Compliance | ||||
| MW | 615.15 g/mol | |||
| HBA | 10 | |||
| HBD | 4 | |||
| HBA + HBD | 14 | |||
| AlogP | 2.69 | |||
| TPSA | 149.95 | |||
| RB | 7 |
Radar chart
PCA : iPPI-DB chemical space
PCA : Correlation circle
Efficiencies: iPPI-DB biplot LE versus LLE
Summary
| Bibliographic ressources | Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|---|
| 1 | 1 | 1 | 0 | 0 |
Pharmacological data
| Bibliography | Name | Target | Competition | Assay type | Assay name | Cell line | Activity type | Activity |
|---|---|---|---|---|---|---|---|---|
| 10.1126/science.1092472 | 10 | MDM2 Q00987 |
P53 P04637 |
Biochemical assay | HTRF | pIC50 (half maximal inhibitory concentration, -log10) | 7.60 | |
| 10.1126/science.1092472 | 10 | MDM2 Q00987 |
P53 P04637 |
Cellular assay | MTT-assay | SJSA-1 cells | pIC50 (half maximal inhibitory concentration, -log10) | 7.00 |
| Ta | Structure | Name | Drugbank ID |
|---|---|---|---|
| 0.6897 | Idasanutlin | DB12325 | |
| 0.6466 | SAR-405838 | DB12541 | |
| 0.5821 | Milademetan | DB15257 | |
| 0.4925 | MK-3207 | DB12424 | |
| 0.4912 | Ubrogepant | DB15328 | |
| 0.4781 | Ipatasertib | DB11743 | |
| 0.4717 | Degarelix | DB06699 | |
| 0.4697 | Volasertib | DB12062 | |
| 0.4482 | Bremelanotide | DB11653 | |
| 0.4471 | Angiotensinamide | DB13517 | |
| 0.4440 | Cotadutide | DB15194 | |
| 0.4433 | Semaglutide | DB13928 | |
| 0.4420 | Afamelanotide | DB04931 | |
| 0.4410 | Zilucoplan | DB15636 | |
| 0.4404 | Taspoglutide | DB14027 |




