Compound 2329
Identifiers
- Canonical SMILES:
COc1cc(ccc1NC(=O)C1NC(CC(C)(C)C)C2(C1c1cccc(Cl)c1F)C(=O)Nc1cc(Cl)cnc21)C(N)=O
- IUPAC name:
N-(4-carbamoyl-2-methoxyphenyl)-6'-chloro-4-(3-chloro-2-fluorophenyl)-2-(2,2-dimethylpropyl)-2'-oxo-1',2'-dihydrospiro[pyrrolidine-3,3'-pyrrolo[3,2-b]pyridine]-5-carboxamide
- InChi:
InChI=1S/C30H30Cl2FN5O4/c1-29(2,3)12-21-30(25-19(37-28(30)41)11-15(31)13-35-25)22(16-6-5-7-17(32)23(16)33)24(38-21)27(40)36-18-9-8-14(26(34)39)10-20(18)42-4/h5-11,13,21-22,24,38H,12H2,1-4H3,(H2,34,39)(H,36,40)(H,37,41)
- InChiKey:
ACHCLOSSNAELCR-UHFFFAOYSA-N
External links
![]() 66761262 |
External search
|
|
|
|
|
Bibliography (1)
| Publication | Name |
|---|---|
| Vassilev L. T.. . In Vivo Activation of the p53 Pathway by Small-Molecule Antagonists of MDM2 Science. | 9 |
Pharmacological data
| Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|
| 1 | 1 | 0 | 0 |
Targets
| PPI family | Best activity | Diseases | MMoA |
|---|---|---|---|
| MDM2-Like / P53 | 7.38 | cancer | Inhibition |
Physicochemical filters
| Descriptor | Lipinski's RO5 | Veber | Pfizer's 3/75 | |
|---|---|---|---|---|
| Compliance | ||||
| MW | 613.17 g/mol | |||
| HBA | 9 | |||
| HBD | 5 | |||
| HBA + HBD | 14 | |||
| AlogP | 4.55 | |||
| TPSA | 140.02 | |||
| RB | 7 |
Radar chart
PCA : iPPI-DB chemical space
PCA : Correlation circle
Efficiencies: iPPI-DB biplot LE versus LLE
Summary
| Bibliographic ressources | Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|---|
| 1 | 1 | 1 | 0 | 0 |
Pharmacological data
| Bibliography | Name | Target | Competition | Assay type | Assay name | Cell line | Activity type | Activity |
|---|---|---|---|---|---|---|---|---|
| 10.1126/science.1092472 | 9 | MDM2 Q00987 |
P53 P04637 |
Biochemical assay | HTRF | pIC50 (half maximal inhibitory concentration, -log10) | 7.28 | |
| 10.1126/science.1092472 | 9 | MDM2 Q00987 |
P53 P04637 |
Cellular assay | MTT-assay | SJSA-1 cells | pIC50 (half maximal inhibitory concentration, -log10) | 7.38 |
| Ta | Structure | Name | Drugbank ID |
|---|---|---|---|
| 0.6481 | SAR-405838 | DB12541 | |
| 0.6417 | Idasanutlin | DB12325 | |
| 0.6136 | Milademetan | DB15257 | |
| 0.4930 | Ubrogepant | DB15328 | |
| 0.4615 | MK-3207 | DB12424 | |
| 0.4572 | Degarelix | DB06699 | |
| 0.4558 | Ivosidenib | DB14568 | |
| 0.4348 | Timcodar | DB12761 | |
| 0.4310 | OPC-51803 | DB05838 | |
| 0.4300 | Cipargamin | DB12306 | |
| 0.4274 | OPC-14523 | DB05422 | |
| 0.4202 | Abarelix | DB00106 | |
| 0.4188 | Bremelanotide | DB11653 | |
| 0.4186 | Saquinavir | DB01232 | |
| 0.4184 | Afamelanotide | DB04931 |




