Compound 2328
Identifiers
- Canonical SMILES:
COc1cc(ccc1NC(=O)C1NC(CC(C)(C)C)C2(C1c1cccc(Cl)c1F)C(=O)Nc1cc(Cl)cnc21)C(O)=O
- IUPAC name:
4-{[6'-chloro-4-(3-chloro-2-fluorophenyl)-2-(2,2-dimethylpropyl)-2'-oxo-1',2'-dihydrospiro[pyrrolidine-3,3'-pyrrolo[3,2-b]pyridin]-5-yl]amido}-3-methoxybenzoic acid - InChi:
InChI=1S/C30H29Cl2FN4O5/c1-29(2,3)12-21-30(25-19(36-28(30)41)11-15(31)13-34-25)22(16-6-5-7-17(32)23(16)33)24(37-21)26(38)35-18-9-8-14(27(39)40)10-20(18)42-4/h5-11,13,21-22,24,37H,12H2,1-4H3,(H,35,38)(H,36,41)(H,39,40)
- InChiKey:
IJIGMWANDSKYOG-UHFFFAOYSA-N
External links
![]() 76468674 |
External search
|
|
|
|
|
Bibliography (1)
| Publication | Name |
|---|---|
| Vassilev L. T.. . In Vivo Activation of the p53 Pathway by Small-Molecule Antagonists of MDM2 Science. | 8 |
Pharmacological data
| Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|
| 1 | 1 | 0 | 0 |
Targets
| PPI family | Best activity | Diseases | MMoA |
|---|---|---|---|
| MDM2-Like / P53 | 7.34 | cancer | Inhibition |
Physicochemical filters
| Descriptor | Lipinski's RO5 | Veber | Pfizer's 3/75 | |
|---|---|---|---|---|
| Compliance | ||||
| MW | 614.15 g/mol | |||
| HBA | 9 | |||
| HBD | 4 | |||
| HBA + HBD | 13 | |||
| AlogP | 2.88 | |||
| TPSA | 137.06 | |||
| RB | 7 |
Radar chart
PCA : iPPI-DB chemical space
PCA : Correlation circle
Efficiencies: iPPI-DB biplot LE versus LLE
Summary
| Bibliographic ressources | Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|---|
| 1 | 1 | 1 | 0 | 0 |
Pharmacological data
| Bibliography | Name | Target | Competition | Assay type | Assay name | Cell line | Activity type | Activity |
|---|---|---|---|---|---|---|---|---|
| 10.1126/science.1092472 | 8 | MDM2 Q00987 |
P53 P04637 |
Biochemical assay | HTRF | pIC50 (half maximal inhibitory concentration, -log10) | 7.34 | |
| 10.1126/science.1092472 | 8 | MDM2 Q00987 |
P53 P04637 |
Cellular assay | MTT-assay | SJSA-1 cells | pIC50 (half maximal inhibitory concentration, -log10) | 7.21 |
| Ta | Structure | Name | Drugbank ID |
|---|---|---|---|
| 0.6807 | Idasanutlin | DB12325 | |
| 0.6387 | SAR-405838 | DB12541 | |
| 0.6060 | Milademetan | DB15257 | |
| 0.4931 | Ubrogepant | DB15328 | |
| 0.4526 | Degarelix | DB06699 | |
| 0.4464 | MK-3207 | DB12424 | |
| 0.4364 | Ivosidenib | DB14568 | |
| 0.4250 | Bremelanotide | DB11653 | |
| 0.4246 | Afamelanotide | DB04931 | |
| 0.4237 | (2S,3S)-3-AMINO-4-[(3S)-3-FLUOROPYRROLIDIN-1-YL]-N,N-DIMETHYL-4-OXO-2-(TRANS-4-[1,2,4]TRIAZOLO[1,5-A]PYRIDIN-5-YLCYCLOHEXYL)BUTANAMIDE | DB07135 | |
| 0.4216 | Cotadutide | DB15194 | |
| 0.4209 | Albuvirtide | DB15166 | |
| 0.4181 | Taspoglutide | DB14027 | |
| 0.4172 | Semaglutide | DB13928 | |
| 0.4170 | OPC-14523 | DB05422 |




