Compound 2325
Identifiers
- Canonical SMILES:
COc1cc(ccc1NC(=O)C1NC(CC(C)(C)C)C2(C1c1cccc(Cl)c1F)C(=O)Nc1ncccc21)C(O)=O
- IUPAC name:
4-{[4-(3-chloro-2-fluorophenyl)-2-(2,2-dimethylpropyl)-2'-oxo-1',2'-dihydrospiro[pyrrolidine-3,3'-pyrrolo[2,3-b]pyridin]-5-yl]amido}-3-methoxybenzoic acid
- InChi:
InChI=1S/C30H30ClFN4O5/c1-29(2,3)14-21-30(17-8-6-12-33-25(17)36-28(30)40)22(16-7-5-9-18(31)23(16)32)24(35-21)26(37)34-19-11-10-15(27(38)39)13-20(19)41-4/h5-13,21-22,24,35H,14H2,1-4H3,(H,34,37)(H,38,39)(H,33,36,40)
- InChiKey:
QLORRPOWHCOBMY-UHFFFAOYSA-N
External links
![]() 76468442 |
External search
![]() |
![]() |
![]() |
![]() |
![]() |
Bibliography (1)
Publication | Name |
---|---|
Vassilev L. T.. . In Vivo Activation of the p53 Pathway by Small-Molecule Antagonists of MDM2 Science. | 5 |
Pharmacological data
Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
---|---|---|---|
1 | 1 | 0 | 0 |
Targets
PPI family | Best activity | Diseases | MMoA |
---|---|---|---|
MDM2-Like / P53 | 7.28 | cancer | Inhibition |
Physicochemical filters
Descriptor | Lipinski's RO5 | Veber | Pfizer's 3/75 | |
---|---|---|---|---|
Compliance | ||||
MW | 580.19 g/mol | |||
HBA | 9 | |||
HBD | 4 | |||
HBA + HBD | 13 | |||
AlogP | 2.49 | |||
TPSA | 137.06 | |||
RB | 7 |
Radar chart
PCA : iPPI-DB chemical space
PCA : Correlation circle
Efficiencies: iPPI-DB biplot LE versus LLE
Summary
Bibliographic ressources | Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
---|---|---|---|---|
1 | 1 | 1 | 0 | 0 |
Pharmacological data
Bibliography | Name | Target | Competition | Assay type | Assay name | Cell line | Activity type | Activity |
---|---|---|---|---|---|---|---|---|
10.1126/science.1092472 | 5 | MDM2 Q00987 |
P53 P04637 |
Biochemical assay | HTRF | pIC50 (half maximal inhibitory concentration, -log10) | 7.28 | |
10.1126/science.1092472 | 5 | MDM2 Q00987 |
P53 P04637 |
Cellular assay | MTT-assay | SJSA-1 cells | pIC50 (half maximal inhibitory concentration, -log10) | 5.86 |
Ta | Structure | Name | Drugbank ID |
---|---|---|---|
0.6795 | Idasanutlin | DB12325 | |
0.6298 | SAR-405838 | DB12541 | |
0.6038 | Milademetan | DB15257 | |
0.5794 | MK-3207 | DB12424 | |
0.5662 | Ubrogepant | DB15328 | |
0.5214 | Degarelix | DB06699 | |
0.4857 | Abarelix | DB00106 | |
0.4835 | Acyline | DB11906 | |
0.4615 | PF-00217830 | DB12998 | |
0.4598 | Daptomycin | DB00080 | |
0.4523 | Ivosidenib | DB14568 | |
0.4518 | Bremelanotide | DB11653 | |
0.4510 | Tifuvirtide | DB05413 | |
0.4495 | Zilucoplan | DB15636 | |
0.4484 | Ozarelix | DB12581 |