Compound 2322
Identifiers
- Canonical SMILES:
COc1cc(ccc1NC(=O)C1NC(CC(C)(C)C)C2(C1c1cccc(Cl)c1F)C(=O)Nc1ccncc21)C(N)=O
- IUPAC name:
N-(4-carbamoyl-2-methoxyphenyl)-4-(3-chloro-2-fluorophenyl)-2-(2,2-dimethylpropyl)-2'-oxo-1',2'-dihydrospiro[pyrrolidine-3,3'-pyrrolo[3,2-c]pyridine]-5-carboxamide
- InChi:
InChI=1S/C30H31ClFN5O4/c1-29(2,3)13-22-30(17-14-34-11-10-19(17)36-28(30)40)23(16-6-5-7-18(31)24(16)32)25(37-22)27(39)35-20-9-8-15(26(33)38)12-21(20)41-4/h5-12,14,22-23,25,37H,13H2,1-4H3,(H2,33,38)(H,35,39)(H,36,40)
- InChiKey:
JZJSBNKVPGNXHW-UHFFFAOYSA-N
External links
![]() 66760052 |
External search
![]() |
![]() |
![]() |
![]() |
![]() |
Bibliography (1)
Publication | Name |
---|---|
Vassilev L. T.. . In Vivo Activation of the p53 Pathway by Small-Molecule Antagonists of MDM2 Science. | 2 |
Pharmacological data
Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
---|---|---|---|
1 | 1 | 0 | 0 |
Targets
PPI family | Best activity | Diseases | MMoA |
---|---|---|---|
MDM2-Like / P53 | 6.85 | cancer | Inhibition |
Physicochemical filters
Descriptor | Lipinski's RO5 | Veber | Pfizer's 3/75 | |
---|---|---|---|---|
Compliance | ||||
MW | 579.20 g/mol | |||
HBA | 9 | |||
HBD | 5 | |||
HBA + HBD | 14 | |||
AlogP | 3.56 | |||
TPSA | 140.02 | |||
RB | 7 |
Radar chart
PCA : iPPI-DB chemical space
PCA : Correlation circle
Efficiencies: iPPI-DB biplot LE versus LLE
Summary
Bibliographic ressources | Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
---|---|---|---|---|
1 | 1 | 1 | 0 | 0 |
Pharmacological data
Bibliography | Name | Target | Competition | Assay type | Assay name | Cell line | Activity type | Activity |
---|---|---|---|---|---|---|---|---|
10.1126/science.1092472 | 2 | MDM2 Q00987 |
P53 P04637 |
Biochemical assay | HTRF | pIC50 (half maximal inhibitory concentration, -log10) | 6.85 | |
10.1126/science.1092472 | 2 | MDM2 Q00987 |
P53 P04637 |
Cellular assay | MTT-assay | SJSA-1 cells | pIC50 (half maximal inhibitory concentration, -log10) | 5.68 |
Ta | Structure | Name | Drugbank ID |
---|---|---|---|
0.6742 | SAR-405838 | DB12541 | |
0.6594 | Idasanutlin | DB12325 | |
0.6414 | Milademetan | DB15257 | |
0.5492 | Degarelix | DB06699 | |
0.5462 | MK-3207 | DB12424 | |
0.5240 | Ubrogepant | DB15328 | |
0.5129 | Abarelix | DB00106 | |
0.5109 | Acyline | DB11906 | |
0.4885 | Daptomycin | DB00080 | |
0.4752 | Tifuvirtide | DB05413 | |
0.4667 | Ozarelix | DB12581 | |
0.4638 | Teverelix | DB05624 | |
0.4621 | Cipargamin | DB12306 | |
0.4615 | TC-6987 | DB14854 | |
0.4577 | Bremelanotide | DB11653 |