Compound 2321
Identifiers
- Canonical SMILES:
COc1cc(ccc1NC(=O)C1NC(CC(C)(C)C)C2(C1c1cccc(Cl)c1F)C(=O)Nc1ccncc21)C(O)=O
- IUPAC name:
4-{[4-(3-chloro-2-fluorophenyl)-2-(2,2-dimethylpropyl)-2'-oxo-1',2'-dihydrospiro[pyrrolidine-3,3'-pyrrolo[3,2-c]pyridin]-5-yl]amido}-3-methoxybenzoic acid - InChi:
InChI=1S/C30H30ClFN4O5/c1-29(2,3)13-22-30(17-14-33-11-10-19(17)35-28(30)40)23(16-6-5-7-18(31)24(16)32)25(36-22)26(37)34-20-9-8-15(27(38)39)12-21(20)41-4/h5-12,14,22-23,25,36H,13H2,1-4H3,(H,34,37)(H,35,40)(H,38,39)
- InChiKey:
ITTQHYXUPNVUBV-UHFFFAOYSA-N
External links
![]() 76468394 |
External search
|
|
|
|
|
Bibliography (1)
| Publication | Name |
|---|---|
| Vassilev L. T.. . In Vivo Activation of the p53 Pathway by Small-Molecule Antagonists of MDM2 Science. | 1 |
Pharmacological data
| Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|
| 1 | 1 | 0 | 0 |
Targets
| PPI family | Best activity | Diseases | MMoA |
|---|---|---|---|
| MDM2-Like / P53 | 7.28 | cancer | Inhibition |
Physicochemical filters
| Descriptor | Lipinski's RO5 | Veber | Pfizer's 3/75 | |
|---|---|---|---|---|
| Compliance | ||||
| MW | 580.19 g/mol | |||
| HBA | 9 | |||
| HBD | 4 | |||
| HBA + HBD | 13 | |||
| AlogP | 1.89 | |||
| TPSA | 137.06 | |||
| RB | 7 |
Radar chart
PCA : iPPI-DB chemical space
PCA : Correlation circle
Efficiencies: iPPI-DB biplot LE versus LLE
Summary
| Bibliographic ressources | Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|---|
| 1 | 1 | 1 | 0 | 0 |
Pharmacological data
| Bibliography | Name | Target | Competition | Assay type | Assay name | Cell line | Activity type | Activity |
|---|---|---|---|---|---|---|---|---|
| 10.1126/science.1092472 | 1 | MDM2 Q00987 |
P53 P04637 |
Biochemical assay | HTRF | pIC50 (half maximal inhibitory concentration, -log10) | 7.28 | |
| 10.1126/science.1092472 | 1 | MDM2 Q00987 |
P53 P04637 |
Cellular assay | MTT-assay | SJSA-1 cells | pIC50 (half maximal inhibitory concentration, -log10) | 4.64 |
| Ta | Structure | Name | Drugbank ID |
|---|---|---|---|
| 0.7004 | Idasanutlin | DB12325 | |
| 0.6637 | SAR-405838 | DB12541 | |
| 0.6328 | Milademetan | DB15257 | |
| 0.5422 | Degarelix | DB06699 | |
| 0.5273 | MK-3207 | DB12424 | |
| 0.5236 | Ubrogepant | DB15328 | |
| 0.5063 | Abarelix | DB00106 | |
| 0.5043 | Acyline | DB11906 | |
| 0.4830 | Daptomycin | DB00080 | |
| 0.4696 | Tifuvirtide | DB05413 | |
| 0.4639 | Bremelanotide | DB11653 | |
| 0.4612 | Ozarelix | DB12581 | |
| 0.4607 | Zilucoplan | DB15636 | |
| 0.4593 | Cotadutide | DB15194 | |
| 0.4583 | Teverelix | DB05624 |




