Compound 2221
Identifiers
- Canonical SMILES:
CCn1c2NC(C)=C(C(c3ccc(C)cc3)c2c(=O)[nH]c1=O)C(=O)OC
- IUPAC name:
methyl 1-ethyl-7-methyl-5-(4-methylphenyl)-2,4-dioxo-1H,2H,3H,4H,5H,8H-pyrido[2,3-d]pyrimidine-6-carboxylate
- InChi:
InChI=1S/C19H21N3O4/c1-5-22-16-15(17(23)21-19(22)25)14(12-8-6-10(2)7-9-12)13(11(3)20-16)18(24)26-4/h6-9,14,20H,5H2,1-4H3,(H,21,23,25)
- InChiKey:
HUNYLEOCQMWUJR-UHFFFAOYSA-N
External links
![]() 137650388 |
![]() CHEMBL4074955 |
OFR |
External search
|
|
|
|
|
Bibliography (1)
Pharmacological data
| Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|
| 2 | 0 | 0 | 0 |
Targets
| PPI family | Best activity | Diseases | MMoA |
|---|---|---|---|
| Bromodomain / Histone | 6.13 | cancer | Inhibition |
Physicochemical filters
| Descriptor | Lipinski's RO5 | Veber | Pfizer's 3/75 | |
|---|---|---|---|---|
| Compliance | ||||
| MW | 355.15 g/mol | |||
| HBA | 7 | |||
| HBD | 2 | |||
| HBA + HBD | 9 | |||
| AlogP | 1.86 | |||
| TPSA | 87.74 | |||
| RB | 4 |
Radar chart
PCA : iPPI-DB chemical space
PCA : Correlation circle
Efficiencies: iPPI-DB biplot LE versus LLE
Summary
| Bibliographic ressources | Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|---|
| 1 | 2 | 0 | 0 | 0 |
Pharmacological data
| Bibliography | Name | Target | Competition | Assay type | Assay name | Cell line | Activity type | Activity |
|---|---|---|---|---|---|---|---|---|
| 28535045 | Compound 3t | BRD4 O60885 |
H4 P62805 |
Biochemical assay | Inhibition of BI-BODIPY binding to BRD4(1) by fluorescence anisotropy | pKi (inhibition constant, -log10) | 6.13 | |
| 28535045 | Compound 3t | BRD4 O60885 |
H4 P62805 |
Biochemical assay | Inhibition of BI-BODIPY binding to BRDT(1) by fluorescence anisotropy | pKi (inhibition constant, -log10) | 5.89 |
| Ta | Structure | Name | Drugbank ID |
|---|---|---|---|
| 0.4046 | Mavacamten | DB14921 | |
| 0.3952 | Alogliptin | DB06203 | |
| 0.3902 | 5-(6-D-ribitylamino-2,4-dihydroxypyrimidin-5-yl)-1-pentyl-phosphonic acid | DB04266 | |
| 0.3864 | LY249543 | DB04322 | |
| 0.3864 | Lometrexol | DB12769 | |
| 0.3855 | IQP-0528 | DB14888 | |
| 0.3813 | Trelagliptin | DB15323 | |
| 0.3785 | (S)-2-Amino-3-(1,3,5,7-Pentahydro-2,4-Dioxo-Cyclopenta[E]Pyrimidin-1-Yl) Proionic Acid | DB03240 | |
| 0.3774 | Niguldipine | DB09239 | |
| 0.3774 | Dexniguldipine | DB14068 | |
| 0.3706 | Cronidipine | DB09233 | |
| 0.3698 | Lercanidipine | DB00528 | |
| 0.3673 | 5-Benzylacyclouridine | DB07437 | |
| 0.3636 | 1-Allyl-3-Butyl-8-(N-Acetyl-4-Aminobenzyl)-Xanthine | DB03267 | |
| 0.3636 | Carboxyethyllumazine | DB03883 |




