Compound 2219
Identifiers
- Canonical SMILES:
CCn1c2NC3=C(C(c4ccc(C)cc4)c2c(=O)[nH]c1=O)C(=O)N(CCc1ccc(OC)cc1)C3
- IUPAC name:
13-ethyl-5-[2-(4-methoxyphenyl)ethyl]-8-(4-methylphenyl)-2,5,11,13-tetraazatricyclo[7.4.0.0^{3,7}]trideca-1(9),3(7)-diene-6,10,12-trione
- InChi:
InChI=1S/C27H28N4O4/c1-4-31-24-23(25(32)29-27(31)34)21(18-9-5-16(2)6-10-18)22-20(28-24)15-30(26(22)33)14-13-17-7-11-19(35-3)12-8-17/h5-12,21,28H,4,13-15H2,1-3H3,(H,29,32,34)
- InChiKey:
MWNUDTXWOMXGKW-UHFFFAOYSA-N
External links
![]() 137657448 |
![]() CHEMBL4103140 |
External search
![]() |
![]() |
![]() |
![]() |
![]() |
Bibliography (1)
Pharmacological data
Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
---|---|---|---|
2 | 1 | 0 | 0 |
Targets
PPI family | Best activity | Diseases | MMoA |
---|---|---|---|
Bromodomain / Histone | 7.00 | cancer | Inhibition |
Physicochemical filters
Descriptor | Lipinski's RO5 | Veber | Pfizer's 3/75 | |
---|---|---|---|---|
Compliance | ||||
MW | 472.21 g/mol | |||
HBA | 8 | |||
HBD | 2 | |||
HBA + HBD | 10 | |||
AlogP | 2.44 | |||
TPSA | 90.98 | |||
RB | 6 |
Radar chart
PCA : iPPI-DB chemical space
PCA : Correlation circle
Efficiencies: iPPI-DB biplot LE versus LLE
Summary
Bibliographic ressources | Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
---|---|---|---|---|
1 | 2 | 1 | 0 | 0 |
Pharmacological data
Bibliography | Name | Target | Competition | Assay type | Assay name | Cell line | Activity type | Activity |
---|---|---|---|---|---|---|---|---|
28535045 | Compound 3r | BRD4 O60885 |
H4 P62805 |
Biochemical assay | Inhibition of BI-BODIPY binding to BRD4(1) by fluorescence anisotropy | pKi (inhibition constant, -log10) | 7.00 | |
28535045 | Compound 3r | BRD4 O60885 |
H4 P62805 |
Biochemical assay | Inhibition of BI-BODIPY binding to BRDT(1) by fluorescence anisotropy | pKi (inhibition constant, -log10) | 6.70 | |
28535045 | Compound 3r | BRD4 O60885 |
H4 P62805 |
Cellular assay | Reduction in cell viability after 72 hrs by MTT assay | MM1S cells | pIC50 (half maximal inhibitory concentration, -log10) | 5.68 |
Ta | Structure | Name | Drugbank ID |
---|---|---|---|
0.4157 | BMS-394136 | DB12067 | |
0.4116 | Alogliptin | DB06203 | |
0.3986 | Trelagliptin | DB15323 | |
0.3853 | Albuvirtide | DB15166 | |
0.3843 | Urapidil | DB12661 | |
0.3799 | N-[2-(1,3-BENZODIOXOL-5-YL)ETHYL]-1-[2-(1H-IMIDAZOL-1-YL)-6-METHYLPYRIMIDIN-4-YL]-D-PROLINAMIDE | DB06916 | |
0.3754 | AMG-510 | DB15569 | |
0.3746 | LY249543 | DB04322 | |
0.3746 | Lometrexol | DB12769 | |
0.3672 | OTL-38 | DB15413 | |
0.3654 | Dorzagliatin | DB15123 | |
0.3648 | Histrelin | DB06788 | |
0.3640 | Ipatasertib | DB11743 | |
0.3621 | Enalkiren | DB03395 | |
0.3559 | Laniquidar | DB12799 |