Compound 2218
Identifiers
- Canonical SMILES:
CCn1c2NC3=C(C(c4ccc(C)cc4)c2c(=O)[nH]c1=O)C(=O)N(CCc1ccccc1)C3
- IUPAC name:
13-ethyl-8-(4-methylphenyl)-5-(2-phenylethyl)-2,5,11,13-tetraazatricyclo[7.4.0.0^{3,7}]trideca-1(9),3(7)-diene-6,10,12-trione - InChi:
InChI=1S/C26H26N4O3/c1-3-30-23-22(24(31)28-26(30)33)20(18-11-9-16(2)10-12-18)21-19(27-23)15-29(25(21)32)14-13-17-7-5-4-6-8-17/h4-12,20,27H,3,13-15H2,1-2H3,(H,28,31,33)
- InChiKey:
DQFBZYXAVHHSEQ-UHFFFAOYSA-N
External links
![]() 137653484 |
![]() CHEMBL4092949 |
External search
|
|
|
|
|
Bibliography (1)
Pharmacological data
| Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|
| 2 | 1 | 0 | 0 |
Targets
| PPI family | Best activity | Diseases | MMoA |
|---|---|---|---|
| Bromodomain / Histone | 6.85 | cancer | Inhibition |
Physicochemical filters
| Descriptor | Lipinski's RO5 | Veber | Pfizer's 3/75 | |
|---|---|---|---|---|
| Compliance | ||||
| MW | 442.20 g/mol | |||
| HBA | 7 | |||
| HBD | 2 | |||
| HBA + HBD | 9 | |||
| AlogP | 2.60 | |||
| TPSA | 81.75 | |||
| RB | 5 |
Radar chart
PCA : iPPI-DB chemical space
PCA : Correlation circle
Efficiencies: iPPI-DB biplot LE versus LLE
Summary
| Bibliographic ressources | Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|---|
| 1 | 2 | 1 | 0 | 0 |
Pharmacological data
| Bibliography | Name | Target | Competition | Assay type | Assay name | Cell line | Activity type | Activity |
|---|---|---|---|---|---|---|---|---|
| 28535045 | Compound 3q | BRD4 O60885 |
H4 P62805 |
Biochemical assay | Inhibition of BI-BODIPY binding to BRD4(1) by fluorescence anisotropy | pKi (inhibition constant, -log10) | 6.85 | |
| 28535045 | Compound 3q | BRD4 O60885 |
H4 P62805 |
Biochemical assay | Inhibition of BI-BODIPY binding to BRDT(1) by fluorescence anisotropy | pKi (inhibition constant, -log10) | 6.66 | |
| 28535045 | Compound 3q | BRD4 O60885 |
H4 P62805 |
Cellular assay | Reduction in cell viability after 72 hrs by MTT assay | MM1S cells | pIC50 (half maximal inhibitory concentration, -log10) | 5.92 |
| Ta | Structure | Name | Drugbank ID |
|---|---|---|---|
| 0.4302 | Alogliptin | DB06203 | |
| 0.4161 | Trelagliptin | DB15323 | |
| 0.4136 | BMS-394136 | DB12067 | |
| 0.3854 | LY249543 | DB04322 | |
| 0.3854 | Lometrexol | DB12769 | |
| 0.3746 | Ipatasertib | DB11743 | |
| 0.3683 | AMG-510 | DB15569 | |
| 0.3646 | IQP-0528 | DB14888 | |
| 0.3636 | Risperidone | DB00734 | |
| 0.3627 | 2-({8-[(3R)-3-AMINOPIPERIDIN-1-YL]-1,3-DIMETHYL-2,6-DIOXO-1,2,3,6-TETRAHYDRO-7H-PURIN-7-YL}METHYL)BENZONITRILE | DB08743 | |
| 0.3620 | Albuvirtide | DB15166 | |
| 0.3547 | Urapidil | DB12661 | |
| 0.3538 | 5-(6-D-ribitylamino-2,4-dihydroxypyrimidin-5-yl)-1-pentyl-phosphonic acid | DB04266 | |
| 0.3528 | (2E,3S)-3-hydroxy-5'-[(4-hydroxypiperidin-1-yl)sulfonyl]-3-methyl-1,3-dihydro-2,3'-biindol-2'(1'H)-one | DB03583 | |
| 0.3522 | Paliperidone | DB01267 |




