Compound 2217
Identifiers
- Canonical SMILES:
CCn1c2NC3=C(C(c4ccc(C)cc4)c2c(=O)[nH]c1=O)C(=O)N(Cc1ccccc1)C3
- IUPAC name:
5-benzyl-13-ethyl-8-(4-methylphenyl)-2,5,11,13-tetraazatricyclo[7.4.0.0^{3,7}]trideca-1(9),3(7)-diene-6,10,12-trione
- InChi:
InChI=1S/C25H24N4O3/c1-3-29-22-21(23(30)27-25(29)32)19(17-11-9-15(2)10-12-17)20-18(26-22)14-28(24(20)31)13-16-7-5-4-6-8-16/h4-12,19,26H,3,13-14H2,1-2H3,(H,27,30,32)
- InChiKey:
ZBRDRGVJFCJFQS-UHFFFAOYSA-N
External links
![]() 137632577 |
![]() CHEMBL4065286 |
External search
![]() |
![]() |
![]() |
![]() |
![]() |
Bibliography (1)
Pharmacological data
Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
---|---|---|---|
2 | 1 | 0 | 0 |
Targets
PPI family | Best activity | Diseases | MMoA |
---|---|---|---|
Bromodomain / Histone | 6.72 | cancer | Inhibition |
Physicochemical filters
Descriptor | Lipinski's RO5 | Veber | Pfizer's 3/75 | |
---|---|---|---|---|
Compliance | ||||
MW | 428.18 g/mol | |||
HBA | 7 | |||
HBD | 2 | |||
HBA + HBD | 9 | |||
AlogP | 2.31 | |||
TPSA | 81.75 | |||
RB | 4 |
Radar chart
PCA : iPPI-DB chemical space
PCA : Correlation circle
Efficiencies: iPPI-DB biplot LE versus LLE
Summary
Bibliographic ressources | Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
---|---|---|---|---|
1 | 2 | 1 | 0 | 0 |
Pharmacological data
Bibliography | Name | Target | Competition | Assay type | Assay name | Cell line | Activity type | Activity |
---|---|---|---|---|---|---|---|---|
28535045 | Compound 3p | BRD4 O60885 |
H4 P62805 |
Biochemical assay | Inhibition of BI-BODIPY binding to BRD4(1) by fluorescence anisotropy | pKi (inhibition constant, -log10) | 6.72 | |
28535045 | Compound 3p | BRD4 O60885 |
H4 P62805 |
Biochemical assay | Inhibition of BI-BODIPY binding to BRDT(1) by fluorescence anisotropy | pKi (inhibition constant, -log10) | 6.64 | |
28535045 | Compound 3p | BRD4 O60885 |
H4 P62805 |
Cellular assay | Reduction in cell viability after 72 hrs by MTT assay | MM1S cells | pIC50 (half maximal inhibitory concentration, -log10) | 5.68 |
Ta | Structure | Name | Drugbank ID |
---|---|---|---|
0.4361 | Alogliptin | DB06203 | |
0.4317 | BMS-394136 | DB12067 | |
0.4218 | Trelagliptin | DB15323 | |
0.4155 | LY249543 | DB04322 | |
0.4155 | Lometrexol | DB12769 | |
0.3852 | Mavacamten | DB14921 | |
0.3689 | Darapladib | DB06311 | |
0.3656 | IQP-0528 | DB14888 | |
0.3650 | AMG-510 | DB15569 | |
0.3636 | 2-({8-[(3R)-3-AMINOPIPERIDIN-1-YL]-1,3-DIMETHYL-2,6-DIOXO-1,2,3,6-TETRAHYDRO-7H-PURIN-7-YL}METHYL)BENZONITRILE | DB08743 | |
0.3604 | Pelitrexol | DB12757 | |
0.3581 | Tasosartan | DB01349 | |
0.3538 | (11R)-10-acetyl-11-(2,4-dichlorophenyl)-6-hydroxy-3,3-dimethyl-2,3,4,5,10,11-hexahydro-1H-dibenzo[b,e][1,4]diazepin-1-one | DB08747 | |
0.3508 | Urapidil | DB12661 | |
0.3500 | 5-(6-D-ribitylamino-2,4-dihydroxypyrimidin-5-yl)-1-pentyl-phosphonic acid | DB04266 |