Compound 2213
Identifiers
- Canonical SMILES:
CCn1c2NC3=C(C(c4ccc(C)cc4)c2c(=O)[nH]c1=O)C(=O)N(C)C3
- IUPAC name:
13-ethyl-5-methyl-8-(4-methylphenyl)-2,5,11,13-tetraazatricyclo[7.4.0.0^{3,7}]trideca-1(9),3(7)-diene-6,10,12-trione - InChi:
InChI=1S/C19H20N4O3/c1-4-23-16-15(17(24)21-19(23)26)13(11-7-5-10(2)6-8-11)14-12(20-16)9-22(3)18(14)25/h5-8,13,20H,4,9H2,1-3H3,(H,21,24,26)
- InChiKey:
XBNYMTXJOBYHMR-UHFFFAOYSA-N
External links
![]() 137636712 |
![]() CHEMBL4064204 |
XZG |
External search
|
|
|
|
|
Bibliography (1)
Pharmacological data
| Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|
| 2 | 0 | 0 | 0 |
Targets
| PPI family | Best activity | Diseases | MMoA |
|---|---|---|---|
| Bromodomain / Histone | 5.60 | cancer | Inhibition |
Physicochemical filters
| Descriptor | Lipinski's RO5 | Veber | Pfizer's 3/75 | |
|---|---|---|---|---|
| Compliance | ||||
| MW | 352.15 g/mol | |||
| HBA | 7 | |||
| HBD | 2 | |||
| HBA + HBD | 9 | |||
| AlogP | 0.59 | |||
| TPSA | 81.75 | |||
| RB | 2 |
Radar chart
PCA : iPPI-DB chemical space
PCA : Correlation circle
Efficiencies: iPPI-DB biplot LE versus LLE
Summary
| Bibliographic ressources | Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|---|
| 1 | 2 | 0 | 0 | 0 |
Pharmacological data
| Bibliography | Name | Target | Competition | Assay type | Assay name | Cell line | Activity type | Activity |
|---|---|---|---|---|---|---|---|---|
| 28535045 | Compound 3l | BRD4 O60885 |
H4 P62805 |
Biochemical assay | Inhibition of BI-BODIPY binding to BRD4(1) by fluorescence anisotropy | pKi (inhibition constant, -log10) | 5.60 | |
| 28535045 | Compound 3l | BRD4 O60885 |
H4 P62805 |
Biochemical assay | Inhibition of BI-BODIPY binding to BRDT(1) by fluorescence anisotropy | pKi (inhibition constant, -log10) | 5.25 |
| Ta | Structure | Name | Drugbank ID |
|---|---|---|---|
| 0.4264 | Alogliptin | DB06203 | |
| 0.4120 | Trelagliptin | DB15323 | |
| 0.3957 | LY249543 | DB04322 | |
| 0.3957 | Lometrexol | DB12769 | |
| 0.3925 | BMS-394136 | DB12067 | |
| 0.3701 | Urapidil | DB12661 | |
| 0.3694 | IQP-0528 | DB14888 | |
| 0.3684 | 5-(6-D-ribitylamino-2,4-dihydroxypyrimidin-5-yl)-1-pentyl-phosphonic acid | DB04266 | |
| 0.3671 | Mavacamten | DB14921 | |
| 0.3646 | Ipatasertib | DB11743 | |
| 0.3588 | Risperidone | DB00734 | |
| 0.3556 | AMG-510 | DB15569 | |
| 0.3525 | 2-({8-[(3R)-3-AMINOPIPERIDIN-1-YL]-1,3-DIMETHYL-2,6-DIOXO-1,2,3,6-TETRAHYDRO-7H-PURIN-7-YL}METHYL)BENZONITRILE | DB08743 | |
| 0.3480 | (2E,3S)-3-hydroxy-5'-[(4-hydroxypiperidin-1-yl)sulfonyl]-3-methyl-1,3-dihydro-2,3'-biindol-2'(1'H)-one | DB03583 | |
| 0.3473 | Paliperidone | DB01267 |




