Compound 2212
Identifiers
- Canonical SMILES:
CCn1c2NC3=C(C(c4ccc(C)cc4)c2c(=O)[nH]c1=O)C(=O)CC3
- IUPAC name:
13-ethyl-8-(4-methylphenyl)-2,11,13-triazatricyclo[7.4.0.0^{3,7}]trideca-1(9),3(7)-diene-6,10,12-trione - InChi:
InChI=1S/C19H19N3O3/c1-3-22-17-16(18(24)21-19(22)25)14(11-6-4-10(2)5-7-11)15-12(20-17)8-9-13(15)23/h4-7,14,20H,3,8-9H2,1-2H3,(H,21,24,25)
- InChiKey:
GFYQCHZFSLHBOA-UHFFFAOYSA-N
External links
![]() 137654718 |
![]() CHEMBL4093510 |
External search
|
|
|
|
|
Bibliography (1)
Pharmacological data
| Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|
| 2 | 0 | 0 | 0 |
Targets
| PPI family | Best activity | Diseases | MMoA |
|---|---|---|---|
| Bromodomain / Histone | 5.00 | cancer | Inhibition |
Physicochemical filters
| Descriptor | Lipinski's RO5 | Veber | Pfizer's 3/75 | |
|---|---|---|---|---|
| Compliance | ||||
| MW | 337.14 g/mol | |||
| HBA | 6 | |||
| HBD | 2 | |||
| HBA + HBD | 8 | |||
| AlogP | 1.68 | |||
| TPSA | 78.51 | |||
| RB | 2 |
Radar chart
PCA : iPPI-DB chemical space
PCA : Correlation circle
Efficiencies: iPPI-DB biplot LE versus LLE
Summary
| Bibliographic ressources | Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|---|
| 1 | 2 | 0 | 0 | 0 |
Pharmacological data
| Bibliography | Name | Target | Competition | Assay type | Assay name | Cell line | Activity type | Activity |
|---|---|---|---|---|---|---|---|---|
| 28535045 | Compound 3k | BRD4 O60885 |
H4 P62805 |
Biochemical assay | Inhibition of BI-BODIPY binding to BRD4(1) by fluorescence anisotropy | pKi (inhibition constant, -log10) | 5.00 | |
| 28535045 | Compound 3k | BRD4 O60885 |
H4 P62805 |
Biochemical assay | Inhibition of BI-BODIPY binding to BRDT(1) by fluorescence anisotropy | pKi (inhibition constant, -log10) | 4.64 |
| Ta | Structure | Name | Drugbank ID |
|---|---|---|---|
| 0.4444 | LY249543 | DB04322 | |
| 0.4444 | Lometrexol | DB12769 | |
| 0.4350 | 5-(6-D-ribitylamino-2,4-dihydroxypyrimidin-5-yl)-1-pentyl-phosphonic acid | DB04266 | |
| 0.4111 | Alogliptin | DB06203 | |
| 0.3970 | Trelagliptin | DB15323 | |
| 0.3941 | Pelitrexol | DB12757 | |
| 0.3911 | Mavacamten | DB14921 | |
| 0.3891 | (S)-2-Amino-3-(1,3,5,7-Pentahydro-2,4-Dioxo-Cyclopenta[E]Pyrimidin-1-Yl) Proionic Acid | DB03240 | |
| 0.3783 | 6-(4-{[2-(3-iodobenzyl)-3-oxocyclohex-1-en-1-yl]amino}phenyl)-5-methyl-4,5-dihydropyridazin-3(2H)-one | DB01640 | |
| 0.3745 | IQP-0528 | DB14888 | |
| 0.3678 | LY-2334737 | DB12906 | |
| 0.3630 | Risperidone | DB00734 | |
| 0.3536 | 1-Allyl-3-Butyl-8-(N-Acetyl-4-Aminobenzyl)-Xanthine | DB03267 | |
| 0.3514 | Vibegron | DB14895 | |
| 0.3510 | Paliperidone | DB01267 |




