Compound 2209
Identifiers
- Canonical SMILES:
CCn1c2NC3=C(C(c4ccc(cc4)C(F)(F)F)c2c(=O)[nH]c1=O)C(=O)OC3
- IUPAC name:
13-ethyl-8-[4-(trifluoromethyl)phenyl]-5-oxa-2,11,13-triazatricyclo[7.4.0.0^{3,7}]trideca-1(9),3(7)-diene-6,10,12-trione
- InChi:
InChI=1S/C18H14F3N3O4/c1-2-24-14-13(15(25)23-17(24)27)11(12-10(22-14)7-28-16(12)26)8-3-5-9(6-4-8)18(19,20)21/h3-6,11,22H,2,7H2,1H3,(H,23,25,27)
- InChiKey:
GSQMKFKPHLJZSN-UHFFFAOYSA-N
External links
![]() 137655200 |
![]() CHEMBL4094424 |
External search
![]() |
![]() |
![]() |
![]() |
![]() |
Bibliography (1)
Pharmacological data
Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
---|---|---|---|
2 | 0 | 0 | 0 |
Targets
PPI family | Best activity | Diseases | MMoA |
---|---|---|---|
Bromodomain / Histone | 5.82 | cancer | Inhibition |
Physicochemical filters
Descriptor | Lipinski's RO5 | Veber | Pfizer's 3/75 | |
---|---|---|---|---|
Compliance | ||||
MW | 393.09 g/mol | |||
HBA | 7 | |||
HBD | 2 | |||
HBA + HBD | 9 | |||
AlogP | 1.69 | |||
TPSA | 87.74 | |||
RB | 3 |
Radar chart
PCA : iPPI-DB chemical space
PCA : Correlation circle
Efficiencies: iPPI-DB biplot LE versus LLE
Summary
Bibliographic ressources | Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
---|---|---|---|---|
1 | 2 | 0 | 0 | 0 |
Pharmacological data
Bibliography | Name | Target | Competition | Assay type | Assay name | Cell line | Activity type | Activity |
---|---|---|---|---|---|---|---|---|
28535045 | Compound 3h | BRD4 O60885 |
H4 P62805 |
Biochemical assay | Inhibition of BI-BODIPY binding to BRD4(1) by fluorescence anisotropy | pKi (inhibition constant, -log10) | 5.82 | |
28535045 | Compound 3h | BRD4 O60885 |
H4 P62805 |
Biochemical assay | Inhibition of BI-BODIPY binding to BRDT(1) by fluorescence anisotropy | pKi (inhibition constant, -log10) | 5.43 |
Ta | Structure | Name | Drugbank ID |
---|---|---|---|
0.3901 | Lercanidipine | DB00528 | |
0.3895 | 5-(6-D-ribitylamino-2,4-dihydroxypyrimidin-5-yl)-1-pentyl-phosphonic acid | DB04266 | |
0.3780 | Benidipine | DB09231 | |
0.3763 | LY249543 | DB04322 | |
0.3763 | Lometrexol | DB12769 | |
0.3737 | Manidipine | DB09238 | |
0.3733 | Barnidipine | DB09227 | |
0.3728 | Niguldipine | DB09239 | |
0.3728 | Dexniguldipine | DB14068 | |
0.3674 | Azelnidipine | DB09230 | |
0.3669 | Cronidipine | DB09233 | |
0.3621 | Mavacamten | DB14921 | |
0.3604 | Nicardipine | DB00622 | |
0.3600 | IQP-0528 | DB14888 | |
0.3587 | (S)-2-Amino-3-(1,3,5,7-Pentahydro-2,4-Dioxo-Cyclopenta[E]Pyrimidin-1-Yl) Proionic Acid | DB03240 |