Compound 2205
Identifiers
- Canonical SMILES:
CCCn1c2NC3=C(C(c4ccccc4)c2c(=O)[nH]c1=O)C(=O)OC3
- IUPAC name:
8-phenyl-13-propyl-5-oxa-2,11,13-triazatricyclo[7.4.0.0^{3,7}]trideca-1(9),3(7)-diene-6,10,12-trione - InChi:
InChI=1S/C18H17N3O4/c1-2-8-21-15-14(16(22)20-18(21)24)12(10-6-4-3-5-7-10)13-11(19-15)9-25-17(13)23/h3-7,12,19H,2,8-9H2,1H3,(H,20,22,24)
- InChiKey:
JXTZQNJRSYNAJR-UHFFFAOYSA-N
External links
![]() 16258758 |
![]() CHEMBL4088746 |
External search
|
|
|
|
|
Bibliography (1)
Pharmacological data
| Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|
| 2 | 0 | 0 | 0 |
Targets
| PPI family | Best activity | Diseases | MMoA |
|---|---|---|---|
| Bromodomain / Histone | 5.92 | cancer | Inhibition |
Physicochemical filters
| Descriptor | Lipinski's RO5 | Veber | Pfizer's 3/75 | |
|---|---|---|---|---|
| Compliance | ||||
| MW | 339.12 g/mol | |||
| HBA | 7 | |||
| HBD | 2 | |||
| HBA + HBD | 9 | |||
| AlogP | 1.34 | |||
| TPSA | 87.74 | |||
| RB | 3 |
Radar chart
PCA : iPPI-DB chemical space
PCA : Correlation circle
Efficiencies: iPPI-DB biplot LE versus LLE
Summary
| Bibliographic ressources | Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|---|
| 1 | 2 | 0 | 0 | 0 |
Pharmacological data
| Bibliography | Name | Target | Competition | Assay type | Assay name | Cell line | Activity type | Activity |
|---|---|---|---|---|---|---|---|---|
| 28535045 | Compound 3d | BRD4 O60885 |
H4 P62805 |
Biochemical assay | Inhibition of BI-BODIPY binding to BRD4(1) by fluorescence anisotropy | pKi (inhibition constant, -log10) | 5.92 | |
| 28535045 | Compound 3d | BRD4 O60885 |
H4 P62805 |
Biochemical assay | Inhibition of BI-BODIPY binding to BRDT(1) by fluorescence anisotropy | pKi (inhibition constant, -log10) | 5.62 |
| Ta | Structure | Name | Drugbank ID |
|---|---|---|---|
| 0.3885 | Lercanidipine | DB00528 | |
| 0.3878 | 5-(6-D-ribitylamino-2,4-dihydroxypyrimidin-5-yl)-1-pentyl-phosphonic acid | DB04266 | |
| 0.3768 | Manidipine | DB09238 | |
| 0.3763 | Benidipine | DB09231 | |
| 0.3715 | Barnidipine | DB09227 | |
| 0.3710 | Niguldipine | DB09239 | |
| 0.3710 | Dexniguldipine | DB14068 | |
| 0.3697 | LY249543 | DB04322 | |
| 0.3697 | Lometrexol | DB12769 | |
| 0.3656 | Mavacamten | DB14921 | |
| 0.3655 | Azelnidipine | DB09230 | |
| 0.3633 | Nicardipine | DB00622 | |
| 0.3616 | (S)-2-Amino-3-(1,3,5,7-Pentahydro-2,4-Dioxo-Cyclopenta[E]Pyrimidin-1-Yl) Proionic Acid | DB03240 | |
| 0.3616 | Alogliptin | DB06203 | |
| 0.3607 | Cronidipine | DB09233 |




