Compound 2174
Identifiers
- Canonical SMILES:
COc1cc(N=Nc2ccc(cc2)S(=O)(=O)Nc2ccccn2)c(N)cc1O
- IUPAC name:
4-[2-(2-amino-4-hydroxy-5-methoxyphenyl)diazen-1-yl]-N-(pyridin-2-yl)benzene-1-sulfonamide
- InChi:
InChI=1S/C18H17N5O4S/c1-27-17-11-15(14(19)10-16(17)24)22-21-12-5-7-13(8-6-12)28(25,26)23-18-4-2-3-9-20-18/h2-11,24H,19H2,1H3,(H,20,23)
- InChiKey:
ZWOSMSLARGAJPG-UHFFFAOYSA-N
External links
![]() 136224170 |
External search
|
|
|
|
|
Bibliography (1)
Pharmacological data
| Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|
| 2 | 0 | 0 | 0 |
Targets
| PPI family | Best activity | Diseases | MMoA |
|---|---|---|---|
| Bromodomain / Histone | 5.89 | cancer | Inhibition |
Physicochemical filters
| Descriptor | Lipinski's RO5 | Veber | Pfizer's 3/75 | |
|---|---|---|---|---|
| Compliance | ||||
| MW | 399.10 g/mol | |||
| HBA | 9 | |||
| HBD | 4 | |||
| HBA + HBD | 13 | |||
| AlogP | 2.95 | |||
| TPSA | 136.46 | |||
| RB | 5 |
Radar chart
PCA : iPPI-DB chemical space
PCA : Correlation circle
Efficiencies: iPPI-DB biplot LE versus LLE
Summary
| Bibliographic ressources | Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|---|
| 1 | 2 | 0 | 0 | 0 |
Pharmacological data
| Bibliography | Name | Target | Competition | Assay type | Assay name | Cell line | Activity type | Activity |
|---|---|---|---|---|---|---|---|---|
| 10.1021/jm401334s | Compound 30 | BRD4 O60885 |
H4 P62805 |
Biochemical assay | fluorescence anisotropy competition assay using fluorescein-labeled MS417 and BRD4 BrD1 | pKi (inhibition constant, -log10) | 5.89 | |
| 10.1021/jm401334s | Compound 30 | BRD4 O60885 |
H4 P62805 |
Biochemical assay | fluorescence anisotropy competition assay using fluorescein-labeled MS417 and BRD4 BrD2 | pKi (inhibition constant, -log10) | 5.27 |
| Ta | Structure | Name | Drugbank ID |
|---|---|---|---|
| 0.6812 | Sulfasalazine | DB00795 | |
| 0.6577 | Sulfapyridine | DB00891 | |
| 0.5357 | Sulfamethoxypyridazine | DB13773 | |
| 0.5241 | Sulfaethoxypyridazine | DB11462 | |
| 0.5170 | ABT-751 | DB12254 | |
| 0.5114 | Sulfaquinoxaline | DB11464 | |
| 0.5039 | Sulfameter | DB06821 | |
| 0.4874 | Sulfadiazine | DB00359 | |
| 0.4834 | AMG-131 | DB05490 | |
| 0.4823 | Sulfachlorpyridazine | DB11461 | |
| 0.4730 | N-{3-METHYL-5-[2-(PYRIDIN-4-YLAMINO)-ETHOXY]-PHENYL}-BENZENESULFONAMIDE | DB07944 | |
| 0.4680 | Sulfadoxine | DB01299 | |
| 0.4640 | Sulfaperin | DB13320 | |
| 0.4581 | Sulfadimethoxine | DB06150 | |
| 0.4527 | Chlorsulfaquinoxaline | DB12921 |




