Compound 2165
Identifiers
- Canonical SMILES:
Cc1cc(cc(Cl)c1O)N=Nc1ccc(cc1)S(=O)(=O)Nc1ccccn1
- IUPAC name:
4-[2-(3-chloro-4-hydroxy-5-methylphenyl)diazen-1-yl]-N-(pyridin-2-yl)benzene-1-sulfonamide
- InChi:
InChI=1S/C18H15ClN4O3S/c1-12-10-14(11-16(19)18(12)24)22-21-13-5-7-15(8-6-13)27(25,26)23-17-4-2-3-9-20-17/h2-11,24H,1H3,(H,20,23)
- InChiKey:
KBKXBABMPWUUOW-UHFFFAOYSA-N
External links
![]() 136174612 |
External search
![]() |
![]() |
![]() |
![]() |
![]() |
Bibliography (1)
Pharmacological data
Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
---|---|---|---|
2 | 0 | 0 | 0 |
Targets
PPI family | Best activity | Diseases | MMoA |
---|---|---|---|
Bromodomain / Histone | 5.85 | cancer | Inhibition |
Physicochemical filters
Descriptor | Lipinski's RO5 | Veber | Pfizer's 3/75 | |
---|---|---|---|---|
Compliance | ||||
MW | 402.06 g/mol | |||
HBA | 7 | |||
HBD | 2 | |||
HBA + HBD | 9 | |||
AlogP | 5.06 | |||
TPSA | 104.04 | |||
RB | 4 |
Radar chart
PCA : iPPI-DB chemical space
PCA : Correlation circle
Efficiencies: iPPI-DB biplot LE versus LLE
Summary
Bibliographic ressources | Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
---|---|---|---|---|
1 | 2 | 0 | 0 | 0 |
Pharmacological data
Bibliography | Name | Target | Competition | Assay type | Assay name | Cell line | Activity type | Activity |
---|---|---|---|---|---|---|---|---|
10.1021/jm401334s | Compound 21 | BRD4 O60885 |
H4 P62805 |
Biochemical assay | fluorescence anisotropy competition assay using fluorescein-labeled MS417 and BRD4 BrD1 | pKi (inhibition constant, -log10) | 5.85 | |
10.1021/jm401334s | Compound 21 | BRD4 O60885 |
H4 P62805 |
Biochemical assay | fluorescence anisotropy competition assay using fluorescein-labeled MS417 and BRD4 BrD2 | pKi (inhibition constant, -log10) | 5.32 |
Ta | Structure | Name | Drugbank ID |
---|---|---|---|
0.7879 | Sulfasalazine | DB00795 | |
0.6348 | Sulfapyridine | DB00891 | |
0.5106 | Sulfachlorpyridazine | DB11461 | |
0.5103 | Chlorsulfaquinoxaline | DB12921 | |
0.5000 | 2-(6-{[(3-chloro-2-methylphenyl)sulfonyl]amino}pyridin-2-yl)-N,N-diethylacetamide | DB07056 | |
0.4963 | Sulfaquinoxaline | DB11464 | |
0.4841 | Sulfaperin | DB13320 | |
0.4820 | Sulfabromomethazine | DB11547 | |
0.4812 | Sulfamethazine | DB01582 | |
0.4805 | AMG-131 | DB05490 | |
0.4715 | Sulfadiazine | DB00359 | |
0.4662 | Sulfameter | DB06821 | |
0.4662 | Sulfamerazine | DB01581 | |
0.4610 | Sulfaethoxypyridazine | DB11462 | |
0.4605 | N-{3-METHYL-5-[2-(PYRIDIN-4-YLAMINO)-ETHOXY]-PHENYL}-BENZENESULFONAMIDE | DB07944 |