Compound 2160
Identifiers
- Canonical SMILES:
Cc1cc(cc(C)c1O)N=Nc1ccc(cc1)S(=O)(=O)Nc1ccc(F)cn1
- IUPAC name:
N-(5-fluoropyridin-2-yl)-4-[2-(4-hydroxy-3,5-dimethylphenyl)diazen-1-yl]benzene-1-sulfonamide
- InChi:
InChI=1S/C19H17FN4O3S/c1-12-9-16(10-13(2)19(12)25)23-22-15-4-6-17(7-5-15)28(26,27)24-18-8-3-14(20)11-21-18/h3-11,25H,1-2H3,(H,21,24)
- InChiKey:
STBJKDXYORRTEM-UHFFFAOYSA-N
External links
![]() 136226508 |
External search
|
|
|
|
|
Bibliography (1)
Pharmacological data
| Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|
| 2 | 0 | 0 | 0 |
Targets
| PPI family | Best activity | Diseases | MMoA |
|---|---|---|---|
| Bromodomain / Histone | 5.89 | cancer | Inhibition |
Physicochemical filters
| Descriptor | Lipinski's RO5 | Veber | Pfizer's 3/75 | |
|---|---|---|---|---|
| Compliance | ||||
| MW | 400.10 g/mol | |||
| HBA | 7 | |||
| HBD | 2 | |||
| HBA + HBD | 9 | |||
| AlogP | 5.11 | |||
| TPSA | 101.21 | |||
| RB | 4 |
Radar chart
PCA : iPPI-DB chemical space
PCA : Correlation circle
Efficiencies: iPPI-DB biplot LE versus LLE
Summary
| Bibliographic ressources | Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|---|
| 1 | 2 | 0 | 0 | 0 |
Pharmacological data
| Bibliography | Name | Target | Competition | Assay type | Assay name | Cell line | Activity type | Activity |
|---|---|---|---|---|---|---|---|---|
| 10.1021/jm401334s | Compound 16 | BRD4 O60885 |
H4 P62805 |
Biochemical assay | fluorescence anisotropy competition assay using fluorescein-labeled MS417 and BRD4 BrD1 | pKi (inhibition constant, -log10) | 5.89 | |
| 10.1021/jm401334s | Compound 16 | BRD4 O60885 |
H4 P62805 |
Biochemical assay | fluorescence anisotropy competition assay using fluorescein-labeled MS417 and BRD4 BrD2 | pKi (inhibition constant, -log10) | 5.46 |
| Ta | Structure | Name | Drugbank ID |
|---|---|---|---|
| 0.7647 | Sulfasalazine | DB00795 | |
| 0.6134 | Sulfapyridine | DB00891 | |
| 0.4714 | Sulfaquinoxaline | DB11464 | |
| 0.4692 | Sulfaperin | DB13320 | |
| 0.4672 | Sulfamethazine | DB01582 | |
| 0.4581 | N-{3-METHYL-5-[2-(PYRIDIN-4-YLAMINO)-ETHOXY]-PHENYL}-BENZENESULFONAMIDE | DB07944 | |
| 0.4567 | Sulfadiazine | DB00359 | |
| 0.4551 | 2-(6-{[(3-chloro-2-methylphenyl)sulfonyl]amino}pyridin-2-yl)-N,N-diethylacetamide | DB07056 | |
| 0.4526 | Sulfameter | DB06821 | |
| 0.4526 | Sulfamerazine | DB01581 | |
| 0.4467 | Sulfachlorpyridazine | DB11461 | |
| 0.4402 | Sulfaethoxypyridazine | DB11462 | |
| 0.4387 | Sulfamethoxypyridazine | DB13773 | |
| 0.4384 | Sulfabromomethazine | DB11547 | |
| 0.4348 | ABT-751 | DB12254 |




