Compound 2148
Identifiers
- Canonical SMILES:
Cc1cc(cc(C)c1O)N=Nc1ccc(cc1)S(=O)(=O)Nc1ccccn1
- IUPAC name:
4-[2-(4-hydroxy-3,5-dimethylphenyl)diazen-1-yl]-N-(pyridin-2-yl)benzene-1-sulfonamide
- InChi:
InChI=1S/C19H18N4O3S/c1-13-11-16(12-14(2)19(13)24)22-21-15-6-8-17(9-7-15)27(25,26)23-18-5-3-4-10-20-18/h3-12,24H,1-2H3,(H,20,23)
- InChiKey:
UPZISPNEBVCTRN-UHFFFAOYSA-N
External links
![]() 135566898 |
435 |
External search
![]() |
![]() |
![]() |
![]() |
![]() |
Bibliography (1)
Pharmacological data
Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
---|---|---|---|
4 | 2 | 0 | 1 |
Targets
PPI family | Best activity | Diseases | MMoA |
---|---|---|---|
Bromodomain / Histone | 6.04 | cancer | Inhibition |
Physicochemical filters
Descriptor | Lipinski's RO5 | Veber | Pfizer's 3/75 | |
---|---|---|---|---|
Compliance | ||||
MW | 382.11 g/mol | |||
HBA | 7 | |||
HBD | 2 | |||
HBA + HBD | 9 | |||
AlogP | 4.97 | |||
TPSA | 101.21 | |||
RB | 4 |
Radar chart
PCA : iPPI-DB chemical space
PCA : Correlation circle
Efficiencies: iPPI-DB biplot LE versus LLE
Summary
Bibliographic ressources | Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
---|---|---|---|---|
1 | 4 | 2 | 0 | 1 |
Pharmacological data
Bibliography | Name | Target | Competition | Assay type | Assay name | Cell line | Activity type | Activity |
---|---|---|---|---|---|---|---|---|
10.1021/jm401334s | Compound 4, MS435 | BRD4 O60885 |
H4 P62805 |
Biochemical assay | fluorescence anisotropy competition assay using fluorescein-labeled MS417 and BRD4 BrD1 | pKi (inhibition constant, -log10) | 6.04 | |
10.1021/jm401334s | Compound 4, MS435 | BRD4 O60885 |
H4 P62805 |
Biochemical assay | fluorescence anisotropy competition assay using fluorescein-labeled MS417 and BRD4 BrD2 | pKi (inhibition constant, -log10) | 6.04 | |
10.1021/jm401334s | Compound 4, MS435 | BRD4 O60885 |
H4 P62805 |
Biochemical assay | fluorescence anisotropy competition assay using fluorescein-labeled MS574 and BRD3 BrD1 | pKi (inhibition constant, -log10) | 5.79 | |
10.1021/jm401334s | Compound 4, MS435 | BRD4 O60885 |
H4 P62805 |
Biochemical assay | fluorescence anisotropy competition assay using fluorescein-labeled MS574 and BRD3 BrD2 | pKi (inhibition constant, -log10) | 5.61 | |
10.1021/jm401334s | Compound 4, MS435 | BRD4 O60885 |
H4 P62805 |
Cellular assay | Inhibition of BRD4 assessed as inhibition of NF-kappaB-mediated NO production | RAW264.7 cells | pIC50 (half maximal inhibitory concentration, -log10) | 4.33 |
10.1021/jm401334s | Compound 4, MS435 | BRD4 O60885 |
H4 P62805 |
Cellular assay | Inhibition of BRD4 assessed as inhibition of IL-6 expression measured by ELISA | RAW264.7 cells | pIC50 (half maximal inhibitory concentration, -log10) | 4.80 |
Cytotoxicity data
Bibliography | Name | Assay name | Cell line | Compound concentration (μM) | Toxicity |
---|---|---|---|---|---|
10.1021/jm401334s | Compound 4, MS435 | Cell Viability Study of Murine Macrophage Cells | Murinemacrophage RAW264.7 | 50.000 | no |
Ta | Structure | Name | Drugbank ID |
---|---|---|---|
0.8525 | Sulfasalazine | DB00795 | |
0.6952 | Sulfapyridine | DB00891 | |
0.5259 | Sulfaperin | DB13320 | |
0.5238 | Sulfaquinoxaline | DB11464 | |
0.5133 | Sulfadiazine | DB00359 | |
0.5081 | Sulfamethazine | DB01582 | |
0.5041 | Sulfameter | DB06821 | |
0.4930 | N-{3-METHYL-5-[2-(PYRIDIN-4-YLAMINO)-ETHOXY]-PHENYL}-BENZENESULFONAMIDE | DB07944 | |
0.4926 | Sulfachlorpyridazine | DB11461 | |
0.4919 | Sulfamerazine | DB01581 | |
0.4828 | Sulfaethoxypyridazine | DB11462 | |
0.4823 | Sulfamethoxypyridazine | DB13773 | |
0.4762 | ABT-751 | DB12254 | |
0.4737 | Sulfabromomethazine | DB11547 | |
0.4671 | 2-(6-{[(3-chloro-2-methylphenyl)sulfonyl]amino}pyridin-2-yl)-N,N-diethylacetamide | DB07056 |