Compound 2145
Identifiers
- Canonical SMILES:
Cc1cc(N=Nc2cc(c(C)cc2C)S(O)(=O)=O)c(N)cc1O
- IUPAC name:
5-[2-(2-amino-4-hydroxy-5-methylphenyl)diazen-1-yl]-2,4-dimethylbenzene-1-sulfonic acid
- InChi:
InChI=1S/C15H17N3O4S/c1-8-4-10(3)15(23(20,21)22)7-12(8)17-18-13-5-9(2)14(19)6-11(13)16/h4-7,19H,16H2,1-3H3,(H,20,21,22)
- InChiKey:
UUECJWRVDTUDCB-UHFFFAOYSA-N
External links
![]() 135566302 |
J28 |
External search
|
|
|
|
|
Bibliography (1)
Pharmacological data
| Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|
| 2 | 0 | 0 | 0 |
Targets
| PPI family | Best activity | Diseases | MMoA |
|---|---|---|---|
| Bromodomain / Histone | 4.96 | cancer | Inhibition |
Physicochemical filters
| Descriptor | Lipinski's RO5 | Veber | Pfizer's 3/75 | |
|---|---|---|---|---|
| Compliance | ||||
| MW | 335.09 g/mol | |||
| HBA | 7 | |||
| HBD | 4 | |||
| HBA + HBD | 11 | |||
| AlogP | 3.23 | |||
| TPSA | 128.17 | |||
| RB | 3 |
Radar chart
PCA : iPPI-DB chemical space
PCA : Correlation circle
Efficiencies: iPPI-DB biplot LE versus LLE
Summary
| Bibliographic ressources | Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|---|
| 1 | 2 | 0 | 0 | 0 |
Pharmacological data
| Bibliography | Name | Target | Competition | Assay type | Assay name | Cell line | Activity type | Activity |
|---|---|---|---|---|---|---|---|---|
| 10.1021/jm401334s | Compound 1 | BRD4 O60885 |
H4 P62805 |
Biochemical assay | fluorescence anisotropy competition assay using fluorescein-labeled MS417 and BRD4 BrD1 | pKi (inhibition constant, -log10) | 4.96 | |
| 10.1021/jm401334s | Compound 1 | BRD4 O60885 |
H4 P62805 |
Biochemical assay | fluorescence anisotropy competition assay using fluorescein-labeled MS417 and BRD4 BrD2 | pKi (inhibition constant, -log10) | 4.70 |
| Ta | Structure | Name | Drugbank ID |
|---|---|---|---|
| 0.5848 | Trypan blue free acid | DB09158 | |
| 0.4623 | 2-((3',5'-DIMETHYL-4'-HYDROXYPHENYL)AZO)BENZOIC ACID | DB07667 | |
| 0.4528 | 2-((3'-METHYL-4'-HYDROXYPHENYL)AZO)BENZOIC ACID | DB08181 | |
| 0.4464 | 2-((3'-TERTBUTYL-4'-HYDROXYPHENYL)AZO)BENZOIC ACID | DB08216 | |
| 0.4381 | Olsalazine | DB01250 | |
| 0.4214 | Reactive Red 1 Dye | DB03474 | |
| 0.4082 | Reactive Red 6 hapten | DB03853 | |
| 0.4057 | 2-((4'-HYDROXYPHENYL)-AZO)BENZOIC ACID | DB07880 | |
| 0.4019 | 2-((4'-HYDROXYNAPHTHYL)-AZO)BENZOIC ACID | DB08252 | |
| 0.3983 | 2-((3',5'-DIMETHOXY-4'-HYDROXYPHENYL)AZO)BENZOIC ACID | DB08196 | |
| 0.3974 | Sulfasalazine | DB00795 | |
| 0.3889 | p-Toluenesulfonic acid | DB03120 | |
| 0.3842 | Acid yellow 54 free acid | DB03442 | |
| 0.3762 | 2'-HYDROXY-1,1'-BIPHENYL-2-SULFINIC ACID | DB08319 | |
| 0.3759 | Balsalazide | DB01014 |




